|
CAS#: 85959-32-6 Product: N,N-Diethyl-4-({2-methyl-4-[(2-methylphenyl)diazenyl]phenyl}diazenyl)aniline No suppilers available for the product. |
| Name | N,N-Diethyl-4-({2-methyl-4-[(2-methylphenyl)diazenyl]phenyl}diazenyl)aniline |
|---|---|
| Synonyms | N,N-diethyl-4-[[2-methyl-4-[(o-tolyl)azo]phenyl]azo]aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.50 |
| CAS Registry Number | 85959-32-6 |
| EINECS | 289-024-2 |
| SMILES | CCN(CC)c3ccc(N=Nc1ccc(cc1C)N=Nc2ccccc2C)cc3 |
| InChI | 1S/C24H27N5/c1-5-29(6-2)22-14-11-20(12-15-22)25-28-24-16-13-21(17-19(24)4)26-27-23-10-8-7-9-18(23)3/h7-17H,5-6H2,1-4H3 |
| InChIKey | ZDSWNHTYYUFKPX-UHFFFAOYSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.163°C at 760 mmHg (Cal.) |
| Flash point | 291.367°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-4-({2-methyl-4-[(2-methylphenyl)diazenyl]phenyl}diazenyl)aniline |