|
CAS#: 873000-74-9 Product: 4-(4-Chlorophenyl)-3-methyl-4,5-dihydro-1,2-oxazole-4-carboxylic acid No suppilers available for the product. |
| Name | 4-(4-Chlorophenyl)-3-methyl-4,5-dihydro-1,2-oxazole-4-carboxylic acid |
|---|---|
| Synonyms | 4-(4-Chlorophenyl)-3-methyl-4,5-dihydroisoxazole-4-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.65 |
| CAS Registry Number | 873000-74-9 |
| SMILES | CC1=NOCC1(c2ccc(cc2)Cl)C(=O)O |
| InChI | 1S/C11H10ClNO3/c1-7-11(10(14)15,6-16-13-7)8-2-4-9(12)5-3-8/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | QKUUEXJXZGCQFN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.6±52.0°C at 760 mmHg (Cal.) |
| Flash point | 194.3±30.7°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Chlorophenyl)-3-methyl-4,5-dihydro-1,2-oxazole-4-carboxylic acid |