|
CAS#: 91985-81-8 Product: 3-Ethoxy-beta-Carboline No suppilers available for the product. |
| Name | 3-Ethoxy-beta-Carboline |
|---|---|
| Synonyms | 3-Ethoxy-9H-$B-Carboline; 9H-Pyrido(3,4-B)Indole, 3-Ethoxy-; 3-Ethoxy-Beta-Carboline |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 |
| CAS Registry Number | 91985-81-8 |
| SMILES | C1=C2C(=CN=C1OCC)[NH]C3=CC=CC=C23 |
| InChI | 1S/C13H12N2O/c1-2-16-13-7-10-9-5-3-4-6-11(9)15-12(10)8-14-13/h3-8,15H,2H2,1H3 |
| InChIKey | FNNPSIGQQWCKKB-UHFFFAOYSA-N |
| Density | 1.251g/cm3 (Cal.) |
|---|---|
| Boiling point | 405.614°C at 760 mmHg (Cal.) |
| Flash point | 135.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethoxy-beta-Carboline |