|
CAS#: 920-25-2 Product: Triglycine selenate No suppilers available for the product. |
| Name | Triglycine selenate |
|---|---|
| Synonyms | Triglycine Selenate |
| Molecular Structure | ![]() |
| Molecular Formula | C2H7NO6Se |
| Molecular Weight | 220.04 |
| CAS Registry Number | 920-25-2 |
| EINECS | 213-053-1 |
| SMILES | [Se](O)(O)(=O)=O.C(N)C(O)=O |
| InChI | 1S/C2H5NO2.H2O4Se/c3-1-2(4)5;1-5(2,3)4/h1,3H2,(H,4,5);(H2,1,2,3,4) |
| InChIKey | MFPXBAPCIMYWHZ-UHFFFAOYSA-N |
| Boiling point | 240.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 99.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triglycine selenate |