|
CAS#: 922-86-1 Product: Phosphorodithioic acid O,O-dimethyl s-[di(methylcarbamoyl)methyl] ester No suppilers available for the product. |
| Name | Phosphorodithioic acid O,O-dimethyl s-[di(methylcarbamoyl)methyl] ester |
|---|---|
| Synonyms | 2-Acetamido-2-Dimethoxyphosphinothioylsulfanyl-N-Methyl-Acetamide; 2-Acetamido-2-(Dimethoxyphosphinothioylthio)-N-Methylacetamide; 2-Acetamido-2-(Dimethoxythiophosphorylthio)-N-Methyl-Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15N2O4PS2 |
| Molecular Weight | 286.30 |
| CAS Registry Number | 922-86-1 |
| SMILES | CO[P](SC(NC(=O)C)C(=O)NC)(=S)OC |
| InChI | 1S/C7H15N2O4PS2/c1-5(10)9-7(6(11)8-2)16-14(15,12-3)13-4/h7H,1-4H3,(H,8,11)(H,9,10) |
| InChIKey | LFIXITCJCPTJRG-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Phosphorodithioic acid O,O-dimethyl s-[di(methylcarbamoyl)methyl] ester |