|
CAS#: 92412-69-6 Product: 1-Isothiocyanato-4-(trans-4-octylcyclohexyl)benzene No suppilers available for the product. |
| Name | 1-Isothiocyanato-4-(trans-4-octylcyclohexyl)benzene |
|---|---|
| Synonyms | 4-(trans-4'-n-octylcyclohexyl)isothiocyanatobenzene; 4-(trans-4-Octylcyclohexyl)phenyl isothiocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H31NS |
| Molecular Weight | 329.54 |
| CAS Registry Number | 92412-69-6 |
| SMILES | CCCCCCCC[C@H]1CC[C@@H](CC1)c2ccc(cc2)N=C=S |
| InChI | 1S/C21H31NS/c1-2-3-4-5-6-7-8-18-9-11-19(12-10-18)20-13-15-21(16-14-20)22-17-23/h13-16,18-19H,2-12H2,1H3/t18-,19- |
| InChIKey | LPCYDIMBPIGDDK-WGSAOQKQSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.133°C at 760 mmHg (Cal.) |
| Flash point | 241.126°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isothiocyanato-4-(trans-4-octylcyclohexyl)benzene |