|
CAS#: 93892-46-7 Product: 2,2'-(2-Methyl-1,1-propanediyl)bis(6-cyclopentyl-4-methylphenol) No suppilers available for the product. |
| Name | 2,2'-(2-Methyl-1,1-propanediyl)bis(6-cyclopentyl-4-methylphenol) |
|---|---|
| Synonyms | 2,2'-(2-methylpropylidene)bis[6-cyclopentyl-p-cresol] |
| Molecular Structure | ![]() |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.60 |
| CAS Registry Number | 93892-46-7 |
| EINECS | 299-530-5 |
| SMILES | Cc1cc(c(O)c(c1)C2CCCC2)C(c3cc(C)cc(c3O)C4CCCC4)C(C)C |
| InChI | 1S/C28H38O2/c1-17(2)26(24-15-18(3)13-22(27(24)29)20-9-5-6-10-20)25-16-19(4)14-23(28(25)30)21-11-7-8-12-21/h13-17,20-21,26,29-30H,5-12H2,1-4H3 |
| InChIKey | SHCZVYJBDXJGSZ-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.372°C at 760 mmHg (Cal.) |
| Flash point | 192.537°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-(2-Methyl-1,1-propanediyl)bis(6-cyclopentyl-4-methylphenol) |