Online Database of Chemicals from Around the World
|
CAS#: 93980-93-9 Product: 1-(1,1-Dimethylpropyl)-4-(2-Nitrophenoxy)Benzene No suppilers available for the product. |
| Name | 1-(1,1-Dimethylpropyl)-4-(2-Nitrophenoxy)Benzene |
|---|---|
| Synonyms | 1-(1,1-Dimethylpropyl)-4-(2-Nitrophenoxy)Benzene; 1-Tert-Amyl-4-(2-Nitrophenoxy)Benzene |
| Molecular Structure |  |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 |
| CAS Registry Number | 93980-93-9 |
| EINECS | 301-073-4 |
| SMILES | C1=C(C(CC)(C)C)C=CC(=C1)OC2=C([N+]([O-])=O)C=CC=C2 |
| InChI | 1S/C17H19NO3/c1-4-17(2,3)13-9-11-14(12-10-13)21-16-8-6-5-7-15(16)18(19)20/h5-12H,4H2,1-3H3 |
| InChIKey | GEJOEGDFPKMVEQ-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.126°C at 760 mmHg (Cal.) |
| Flash point | 137.892°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1-Dimethylpropyl)-4-(2-Nitrophenoxy)Benzene |