|
CAS#: 94133-59-2 Product: 2-Phenylhex-2-Enal No suppilers available for the product. |
| Name | 2-Phenylhex-2-Enal |
|---|---|
| Synonyms | 2-Phenylhex-2-Enal |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 |
| CAS Registry Number | 94133-59-2 |
| EINECS | 302-720-3 |
| SMILES | C1=C(\C(=C/CCC)C=O)C=CC=C1 |
| InChI | 1S/C12H14O/c1-2-3-7-12(10-13)11-8-5-4-6-9-11/h4-10H,2-3H2,1H3/b12-7- |
| InChIKey | LYAVRIBWJOVBLZ-GHXNOFRVSA-N |
| Density | 0.965g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.98°C at 760 mmHg (Cal.) |
| Flash point | 116.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylhex-2-Enal |