| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Interbioscreen Ltd. | Russian Federation | |||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Name | 9-(4-Methoxyphenyl)-9H-xanthen-9-ol |
|---|---|
| Synonyms | 9-(4-Methoxyphenyl)xanthen-9-ol; ZINC04026861 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.34 |
| CAS Registry Number | 94465-25-5 |
| SMILES | COC1=CC=C(C=C1)C2(C3=CC=CC=C3OC4=CC=CC=C42)O |
| InChI | 1S/C20H16O3/c1-22-15-12-10-14(11-13-15)20(21)16-6-2-4-8-18(16)23-19-9-5-3-7-17(19)20/h2-13,21H,1H3 |
| InChIKey | ZYACEJZTEMQQEU-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 126°C (Expl.) |
| Boiling point | 463.8±45.0°C at 760 mmHg (Cal.) |
| Flash point | 234.3±28.7°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ayesha Jacobs, Luigi R. Nassimbeni, Kanyisa L. Nohako, Gaelle Ramon and Jana H. Taljaard. Enclathration by a xanthenolhostvia solid–solid reactions: structures and kinetics, New J. Chem., 2009, 33, 1960. |
|---|---|
| Market Analysis Reports |