|
CAS#: 958451-74-6 Product: [3-(Difluoromethoxy)-4-methylphenyl]boronic acid No suppilers available for the product. |
| Name | [3-(Difluoromethoxy)-4-methylphenyl]boronic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H9BF2O3 |
| Molecular Weight | 201.96 |
| CAS Registry Number | 958451-74-6 |
| SMILES | B(c1ccc(c(c1)OC(F)F)C)(O)O |
| InChI | 1S/C8H9BF2O3/c1-5-2-3-6(9(12)13)4-7(5)14-8(10)11/h2-4,8,12-13H,1H3 |
| InChIKey | WVVOHJNTNLIDIK-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.509°C at 760 mmHg (Cal.) |
| Flash point | 142.801°C (Cal.) |
| Refractive index | 1.48 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [3-(Difluoromethoxy)-4-methylphenyl]boronic acid |