Online Database of Chemicals from Around the World
|
CAS#: 98025-31-1 Product: S-(1,2,3-Trichlorovinyl)Cysteine No suppilers available for the product. |
| Name | S-(1,2,3-Trichlorovinyl)Cysteine |
|---|---|
| Synonyms | (2R)-2-Amino-3-(1,2,2-Trichlorovinylsulfanyl)Propanoic Acid; (2R)-2-Amino-3-(1,2,2-Trichlorovinylthio)Propanoic Acid; (2R)-2-Amino-3-(1,2,2-Trichlorovinylthio)Propionic Acid |
| Molecular Structure |  |
| Molecular Formula | C5H6Cl3NO2S |
| Molecular Weight | 250.53 |
| CAS Registry Number | 98025-31-1 |
| SMILES | [C@H](CSC(Cl)=C(Cl)Cl)(C(O)=O)N |
| InChI | 1S/C5H6Cl3NO2S/c6-3(7)4(8)12-1-2(9)5(10)11/h2H,1,9H2,(H,10,11)/t2-/m0/s1 |
| InChIKey | AVUYBPJIKGDENR-REOHCLBHSA-N |
| Density | 1.658g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.664°C at 760 mmHg (Cal.) |
| Flash point | 156.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(1,2,3-Trichlorovinyl)Cysteine |