Online Database of Chemicals from Around the World
| Name | 1,3-Difluorotetrachloroacetone |
|---|---|
| Synonyms | 1,1,3,3-Tetrachloro-1,3-Difluoro-Propan-2-One; 1,1,3,3-Tetrachloro-1,3-Difluoro-Acetone; Zinc04329310 |
| Molecular Structure |  |
| Molecular Formula | C3Cl4F2O |
| Molecular Weight | 231.84 |
| CAS Registry Number | 79-51-6 |
| SMILES | O=C(C(F)(Cl)Cl)C(F)(Cl)Cl |
| InChI | 1S/C3Cl4F2O/c4-2(5,8)1(10)3(6,7)9 |
| InChIKey | MXYOKVCIXGJEFW-UHFFFAOYSA-N |
| Desity | 1.76g/cm3 (Cal.) |
|---|---|
| Boiling point | 144.269°C at 760 mmHg (Cal.) |
| 123-125°C (Expl.) | |
| Flash point | 41.053°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Difluorotetrachloroacetone |