Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 9004-99-3 | Polyoxyethylene stearate;Polyethylene glycol monostearate; PEG monostearate | C18H35O2.(C2H4O)n.H |
| 9005-00-9 | Polyethylene glycol monooctadecyl ether;Alkasurf SA 2; Atmer 502; Avivan SO 6; BS 20; Berol 043; Berol 08; Blaunon S 220; Blaunon SR 705; Blaunon SR 707; Blaunon SR 710; Blaunon SR 711; Blaunon SR 715; Blaunon SR 720; Blaunon SR 730; Brij 2; Brij 700; Brij 72; Brij 720; Brij 721; Brij 76; Brij 762; Brij 78; Brij 78P; Brij S 10; Brij S 100; Brij S 100PA-SG; Brij S 20; Cemulsol DB 25/18; Cetalox AT; Disponil O 55; EM 1207; ESK 1; ESK 1 (demulsifier); Ekaline G 80; Emalex 602; Emalex 603; Emalex 605; Emalex 608; Emalex 610; Emalex 611; Emalex 620; Emalex 630; Emalex 640; Emalex GL 15; Emulgen 306P; Emulgen 310; Emulgen 3140S90; Emulgen 320; Emulgen 320L; Emulgen 320P | (C2H4O)n.C18H38O |
| 9005-07-6 | Polyethylene glycol dioleate;Alkamuls 400DO; Alkamuls 600DO; Alkasurf 400DO; Alkasurf 600DO; Atlas G 2242; Chromasist 188A; Chromassist 188A; Cithrol 4DO; Cithrol 6DOX; DO 1000; Emalex 300di-O; Emalex 400di-O; Emalex 600di-O; Emerest 2648; Esterol 244; Esterol 263; Ethox DO 14; Ethox DO 9; G 2242; Ionet DO; Ionet DO 1000; Ionet DO 200; Ionet DO 400; Ionet DO 600; Kessco PEG 1540DO; Lipo-Peg 30; Lipopeg 4DO; Lumulse 42OK; Lumulse 62O; Mapeg 200DO; Mapeg 400DO; Mapeg 6000; Mapeg 600DO; Mapeg L 61; Marlipal FS; Marlosol FS; Nonex 68; Nonex 69; PEG 200 dioleate; PEG 32 dioleate; PEG 400 dioleate; PEG dioleate; Pegnol O 24; Pegosperse 400DO; Pionin D 2506D; Polyethylene glycol dioleate; Polyethylene oxide dioleate; Polyoxyethylene dioleate; Radiasurf 7443; alpha-Oleoyl-omega-(oleoyloxy)poly(oxyethylene) | (C2H4O)n.C36H66O3 |
| 9005-08-7 | Polyethylene glycol distearate;AM 112; AM 113; Atmer 122; Atmer 123; Atmos 150; Atmul 124; Atmul 67; Atmul P 40S; Cadenax GS 90; Cutina MD; Dracorin GMS; Dub GMS; EG 11; Emalex GMS-F; Emulgator C; Estol 1461; Estol 1462; Excel 150; GMS-SE; Geleol; Glycerin stearate; Glycerin stearic acid ester; Glycerol stearate; Glycerol stearic acid ester; Glyceryl stearate; Imwitor 800; Kemester 6000; Lasemul 92N40; Lexemul 515; Lexemul 530; Margamuls; Monogrol; Monomuls 90S18; Nikkol MGS-F 40; Octadecanoic acid glycerol ester; Pationic 1052; Pationic 1052K; Poem S 200; Poem S 95; Polynol; Precirol Special WL 2155; Precirol WL 2155; Pristerene 4913; Pristerene 4931; Rikemal S 200; Rikemal S 200P; Rikemal S 95; Rylo MD 50; S 200; S 95; Safacid 16/18AM; Safacid 16/18MS; Stearin; Stearine; Stepan GMS S.E; Sunsoft 30; T 4; T 4 (glyceride); Tegin 515; Tegin special; Tegomuls 4100; Tegomuls 90S; Vinlub; Witconol MST | (C2H4O)n.C36H70O3 |
| 9005-12-3 | Poly(oxy(methylphenylsilylene));2,4,6-Trimethyl-2,4,6-triphenylcyclotrisiloxane homopolymer, sru; ASI 50; Allied Signal GR 720; Baysilone PL; CP-Sil 8 | (C7H8OSi)n |
| 9005-25-8 | Starch | (C6H10O5)n |
| 9005-27-0 | Hydroxyethyl starch;HES 130/0.4;HES 200/0.5;Starch 2-hydroxyethyl ether | |
| 9005-32-7 | Alginic acid;Alginic acid from Macrocystis pyrifera (kelp); Mixed polymer of mannuronic and guluronic acid | (C12H16O12)n |
| 9005-34-9 | Alginic Acid Ammonium salt | |
| 9005-35-0 | Alginic acid calcium salt;Calcium alginate; Calginate; Combinace; FS-D; FS-W; FS-W (alginate); Flavikafine S; Flavikafine SF-D; Flavikafine SF-W; Grindsted Alginate FD 460 | |
| 9005-36-1 | Alginic acid potassium salt;E 402; KF 200S; Kari Algin K 3; Kelmar; Kelmar improved; Kimica Algin K; Kimica Algin K 3; Kimitsu Algin K; Potassium alginate; Potassium polyalginate; Protanal KF 200; Protanal KF 200RBS; Protaweld EVR 200; SKAT-K 1; SKAT-K-ULV; Stercofuge | |
| 9005-38-3 / 9005-40-7 | Sodium alginate;Alginic acid monosodium salt | C6H9NaO7 |
| 9005-46-3 | Sodium caseinate;Casein sodium salt | |
| 9005-53-2 | Lignin (Dealkaline) | |
| 9005-64-5 | Tween 20 ;Polyoxyethylene sorbitan monolaurate | C18H34O6.(C2H4O)n |
| 9005-65-6 | Tween 80;Polyoxyethylenesorbitan monooleate; Sorbitan monooleate ethoxylate | |
| 9005-66-7 | Polyoxyethylene sorbitan monopalmitate;Tween 40 | C22H42O6.(C2H4O)n |
| 9005-67-8 | Tween 60 ;Polyethylene glycol sorbitan monostearate; Polyoxyethylene sorbitan monostearate | C24H46O6.(C2H4O)n |
| 9005-70-3 | Tween 85;Polyethylene glycol sorbitan trioleate; Polyoxyethylene sorbitan trioleate; Polysorbate 85 | C60H108O8.(C2H4O)n |
| 9005-71-4 | Tween 65;Ahco 7166T; E 436; Emsorb 6907; Ethoxylated sorbitan tristearate; Glycosperse TS 20; Komul NP 4; Liposorb TS 20; Montanox 65; Nikkol TS 30; POE sorbitan tristearate; Poly(oxyethylene) sorbitan tristearate; Polyethylene glycol sorbitan ether tristearate; Polyethylene glycol sorbitan tristearate; Polyethylene glycol sorbitan tristearate ether; Polyoxyethylene 20 sorbitan tristearate; Polysorbate 65; Rheodol TW-S 320; Rheodol TW-S 320V; Sorbimacrogol tristearate 300; Sorgen TW 65; T 65; T-MAZ 65K; TS 30V | |
| 9005-79-2 | Glycogen;(2R,3R,4S,5S,6R)-2-((2R,3S,4R,5R,6R)-4,5-dihydroxy-6-((2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl)oxy-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl)oxymethyl)oxan-3-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol | C24H42O21 |
| 9005-80-5 | Inulin | C12H22O11.C6H12O6 |
| 9005-82-7 | Amylose;Amylose from potato | (C6H10O5)n |
| 9005-84-9 | Starch soluble;Amylodextrin | (C6H10O5)n |
| 9006-26-2 | Ethylene Maleic Anhydride Co-Polymer | C6H6O3 |
| 9006-42-2 | Metiram;Amarex; Carbatene; Metiram-zinc; NIA 9102; Phytox-Super; Polycarbacin; Polycarbacine; Polycarbazin; Polycarbazine; Polykarbacin; Polymarcin; Polymarcine; Polymarsin; Polymarzin; Polymarzine; Polymat; Polyram 2000; Polyram 80; Polyram 80WP; Polyram DF; Polyram combi | |
| 9006-59-1 | Ovalbumin;Egg albumins; Albumin from chicken egg; Protalbinic acid | |
| 9006-65-9 | Dimethicone;Polydimethylsiloxane trimethylsiloxy-terminated | C3H9OSi.(C2H6OSi)n.C3H9Si |
| 9007-16-3 | 2-Methylbutanoic acid | C5H10O2 |
| 9007-28-7 | Chondroitin sulfate ;Poly-1(2/3)-N-acetyl-2-amino-2-deoxy-3-O-beta-D-glucopyranurosyl-4-(6)sulfonyl-D-galactose | (C14H21NO14S)n |
| 9007-34-5 | Collagens polypeptide;L-Lysyl-L-prolylglycyl-L-alpha-glutamyl-L-prolylglycyl-L-prolyl-L-lysine | C25H48N4O5 |
| 9007-41-4 | C-Reactive Protein | |
| 9007-43-6 | Cytochrome C | C42H54FeN8O6S2 |
| 9007-49-2 | Deoxyribonucleic acid;Deoxyribonucleic acids | |
| 9007-58-3 | Elastins;Elastin; E 91; E 91 (elastin) | |
| 9007-83-4 | gamma-Globulins;Blood gamma-globulin; Blood plasma gamma-globulins | |
| 9007-90-3 | Gliadins | |
| 9007-92-5 | Glucagon | |
| 9008-02-0 | Hemoglobins;Blood pigments; Hemoglobin; Deoxyhemoglobins; Ferrohemoglobins; Hemoglobin human | |
| 9008-12-2 | Intrinsic factors;Intrinsic factor; Castle's factor; Castle's gastric factor; Castle's hemopoietic factor; Castle's intrinsic factors; Chromoproteins, intrinsic factors; Gastric intrinsic factor; Intrinsic factors, Castle's; Proteins, specific or class, intrinsic factors | |
| 9008-22-4 | Laminaran;Goemar H 11; Iodus 40; Laminarin | |
| 9008-30-4 | Lysophosphatidylcholines;Phospholipids, lysophosphatidylcholines; QPFC-LC 100; SLP White Lyso; SLP-LPC 70; SLP-Pastelyso; Sunsoft A 1 | |
| 9008-42-8 | Strong protein silver;Albumose silver; Poviargol; Proganol; Protargentum; Protargol; Strong protargin | |
| 9008-45-1 | Myoglobins | |
| 9009-65-8 | Protamines sulfates | |
| 9010-01-9 | Sodium isopentyl sulfate | C5H11NaO4S |
| 9010-34-8 | Thyroglobulin;Thyroglobulins; Elityran; Globulins, thyro; Proloid; Thyractin; Thyroid globulin | |
| 9010-66-6 | Zein | |
| 9010-72-4 | Zymosans | |
| 9010-76-8 | 2-Propenenitrile polymer with 1,1-dichloroethene | C5H5Cl2N |