Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 13682-92-3 | Aluminium glycinate ;Aluminium glycinate; Dihydroxyaluminium glycinate; Glycine aluminum | C2H6AlNO4 |
| 13682-99-0 | Dichloromethylpentyl-Silane | C6H14Cl2Si |
| 13683-41-5 | 1-Bromo-1-(trimethylsilyl)ethylene;alpha-(Trimethylsilyl)vinyl bromide | C5H11BrSi |
| 13683-89-1 | Methyl (3-Hydroxyphenyl)-Carbamate | C8H9NO3 |
| 13684-28-1 | 2-Hydroxy-4-nitrobenzoic acid methyl ester;Methyl 2-hydroxy-4-nitrobenzoate; NSC 165605 | C8H7NO5 |
| 13684-44-1 | Phenmedipham-ethyl;3-Ethoxycarbonylaminophenyl N-3-methylphenylcarbamate; Ethyl N-(3-(N'-(3-methylphenyl)carbamoyloxy)phenyl)carbamate | C17H18N2O4 |
| 13684-56-5 | Desmedipham;(3-(((Phenylamino)carbonyl)oxy)phenyl)carbamic acid ethyl ester | C16H16N2O4 |
| 13684-63-4 | Phenmedipham;3-((Methoxycarbonyl)amino)phenyl (3-methylphenyl)carbamate; 3-Methoxycarbonylaminophenyl N-3-methylphenylcarbamate | C16H16N2O4 |
| 13685-23-9 | P,P-Bis(3-Methylphenyl)-Phosphinous Chloride | C14H14ClP |
| 13685-24-0 | P,P-Bis[4-(Trifluoromethyl)Phenyl]-Phosphinous Chloride | C14H8ClF6P |
| 13685-26-2 | Bis(4-Chlorophenyl)Phosphinous Chloride | C12H8Cl3P |
| 13685-30-8 | Bis(4-Methoxyphenyl)Phosphinous Chloride | C14H14ClO2P |
| 13686-49-2 | 1-(2-Bromoethyl)-Naphthalene | C12H11Br |
| 13686-51-6 | 2-Bromo-1-(1-Naphthyl)Ethanone | C12H9BrO |
| 13686-66-3 | N,N-Diethyl-1,1-Dimethyl-Silanamine | C6H16NSi |
| 13688-55-6 | 2-Propenoic Acid Trimethylsilyl Ester | C6H12O2Si |
| 13688-56-7 | Trimethylsilyl methacrylate;T 3633; Trimethylsilyl 2-methylacrylate | C7H14O2Si |
| 13688-67-0 | 1,10-Undecadiene | C11H20 |
| 13688-68-1 | 9,9-Dimethyl-9H-9-silafluorene;5,5-Dimethyl-5H-dibenzosilole; 9,9-Dimethyl-9-silafluorene; 9,9-Dimethyldibenzosilole; 9,9-Dimethylsilafluorene; NSC 131592 | C14H14Si |
| 13688-90-9 | 4-(Trichlorosilyl)benzyl chloride;Trichloro(4-(chloromethyl)phenyl)silane; (4-(Chloromethyl)phenyl)trichlorosilane; (p-(Chloromethyl)phenyl)trichlorosilane | C7H6Cl4Si |
| 13689-19-5 | Tricyclohexylphosphine oxide | C18H33OP |
| 13689-20-8 | Cyclohexyldiphenyl-Phosphine Oxide | C18H21OP |
| 13689-92-4 | Nickel thiocyanate;Nickel(2+) thiocyanate; Nickel(II) thiocyanate | C10H11NO2 |
| 13691-22-0 | 1-(4-Aminophenyl)pyrrolidin-2-one | C10H12N2O |
| 13691-26-4 | 1-(4-Nitrophenyl)-2-Pyrrolidinone | C10H10N2O3 |
| 13691-28-6 | 1-(4-Aminophenyl)-5-Methylpyrrolidin-2-One | C11H14N2O |
| 13691-84-4 | 3'-Trifluoromethylcyclopentanecarboxanilide | C13H14F3NO |
| 13694-07-0 | 4-(4-Morpholinylmethyl)-2(1H)-Quinolinone | C14H16N2O2 |
| 13694-84-3 | Tetrahydrofuran-3-yl toluene-4-sulfonate;4-Methylbenzenesulfonic acid tetrahydrofuran-3-yl ester; Tetrahydrofuran-3-yl 4-methylbenzenesulfonate | C11H14O4S |
| 13695-31-3 | 2,2,3,3,4,4,4-Heptafluorobutyl methacrylate | C8H7F7O2 |
| 13697-89-7 | 2,6-Difluoroiodobenzene;1,3-Difluoro-2-iodobenzene | C6H3F2I |
| 13698-16-3 | N,N-Dichlorourethane;DCU | C3H5Cl2NO2 |
| 13698-87-8 | N,N,N',N'-tetraethylbenzene-1,3-dicarboxamide | C16H24N2O2 |
| 13700-78-2 | Diethyl 2,6-Bis(Methylsulfanyl)-4-Oxo-4H-Thiopyran-3,5-Dicarboxylate | C13H16O5S3 |
| 13701-64-9 | Calcium borate;Calcium metaborate | Ca(BO2)2.2(H2O) |
| 13702-35-7 | alpha-(Phenylmethylene)-Benzeneacetaldehyde | C15H12O |
| 13703-88-3 | 2,4,6-Tribromoborazine | B3Br3H3N3 |
| 13704-09-1 | (alphaS)-alpha-Hydroxy-Benzeneacetic Acid Ethyl Ester | |
| 13705-05-0 | 2,4-Dichloro-6-(Methylthio)-1,3,5-Triazine | C4H3Cl2N3S |
| 13706-68-8 | Phenylsuccinonitrile | C10H8N2 |
| 13706-86-0 | 5-Methyl-2,3-hexanedione;2-Methylhexa-4,5-dione | C7H12O2 |
| 13707-41-0 | N-Benzylidene-p-toluenesulfonaMide | |
| 13707-88-5 | Alprenolol Hydrochloride | C15H24ClNO2 |
| 13708-12-8 | 5-Methylquinoxaline | C9H8N2 |
| 13708-58-2 | 2-(Indol-1-yl)ethylamine | C10H12N2 |
| 13708-63-9 | Terbium trifluoride;Terbium(III) fluoride | TbF3 |
| 13708-85-5 | Phosphonic Acid Disodium Salt | Na2O3P |
| 13709-05-2 | 3-(Methoxymethoxy)Benzaldehyde | C9H10O3 |
| 13709-31-4 | (T-4)-Trifluorooxo-Vanadium | F3H3OV |
| 13709-36-9 | Xenon Difluoride | F2Xe |