| Reliable Life Science | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 982 588 6288 | |||
![]() |
info@gyangroup.in | |||
| Chemical manufacturer since 2017 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.40 |
| CAS Registry Number | 10128-51-5 |
| EC Number | 680-349-9 |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C3=NC4=CC=CC=C4C(=O)O3 |
| Solubility | 21.33 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.673, Calc.* |
| Melting point | 248.46 ºC |
| Boiling Point | 576.77 ºC, 555.0±43.0 ºC (760 mmHg), Calc.* |
| Flash Point | 289.4±28.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H317-H319-H335-H413 Details |
| Precautionary Statements | P261-P264-P264+P265-P271-P272-P273-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P333+P313-P337+P317-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for N-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide |