| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Unii-62B2FT6RF5 |
|---|---|
| Synonyms | N-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methyl]-N-(2-methylsulfonylethyl)hydroxylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C29H26ClFN4O5S |
| Molecular Weight | 597.06 |
| CAS Registry Number | 1360431-86-2 |
| SMILES | CS(=O)(=O)CCN(CC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl)O |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.662, Calc.* |
| Boiling Point | 793.2±60.0 ºC (760 mmHg), Calc.* |
| Flash Point | 433.5±32.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Unii-62B2FT6RF5 |