|
CAS: 1629618-98-9 Product: Trenbolone Enanthate No suppilers available. |
| Name | Trenbolone Enanthate |
|---|---|
| Synonyms | [(8S,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl] heptanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 |
| CAS Registry Number | 1629618-98-9 |
| SMILES | CCCCCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(C=CC3=C4CCC(=O)C=C4CC[C@@H]23)C |
| Solubility | 0.03779 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.554, Calc.* |
| Melting point | 189.31 ºC |
| Boiling Point | 460.01 ºC, 539.0±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 232.2±30.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H350-H350 Details |
| Precautionary Statements | P264-P280-P301+P312-P308+P313-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Trenbolone Enanthate |