| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | (S)-tert-Butyl 6-cyano-5-hydroxy-3-oxohexanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 312745-90-7 |
| SMILES | CC(C)(C)OC(=O)CC(=O)C[C@H](CC#N)O |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.468, Calc.* |
| Boiling Point | 393.2±32.0 ºC (760 mmHg), Calc.* |
| Flash Point | 191.6±25.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (S)-tert-Butyl 6-cyano-5-hydroxy-3-oxohexanoate |