| Volant Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 19157790159 13456731436 | |||
![]() |
sales@volantgroup.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Analytical chemistry >> Standard >> Spectrometric standard |
|---|---|
| Name | 4-Benzoyloxy-TEMPO benzoate |
| Synonyms | 4-Hydroxy-2,2,6,6-tetramethylpiperidine 1-oxyl benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22NO3 |
| Molecular Weight | 276.35 |
| CAS Registry Number | 3225-26-1 |
| EC Number | 807-702-3 |
| SMILES | CC1(CC(CC(N1[O])(C)C)OC(=O)C2=CC=CC=C2)C |
| Solubility | 43.39 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.555, Calc.* |
| Melting point | 153.99 ºC |
| Boiling Point | 414.99 ºC, 376.8±31.0 ºC (760 mmHg), Calc.* |
| Flash Point | 181.7±24.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H320-H373 Details | ||||||||||||||||||||
| Precautionary Statements | P260-P264-P264+P265-P270-P301+P317-P305+P351+P338-P319-P330-P337+P317-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4-Benzoyloxy-TEMPO benzoate |