| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-(9-Fluorenylmethoxycarbonyl)-(2S,4R)-4-methylproline |
|---|---|
| Synonyms | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-methylpyrrolidine-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 |
| CAS Registry Number | 333777-34-7 |
| EC Number | 861-664-2 |
| SMILES | C[C@@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
| Solubility | 0.334 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.615, Calc.* |
| Melting point | 212.75 ºC |
| Boiling Point | 500.32 ºC, 548.8±43.0 ºC (760 mmHg), Calc.* |
| Flash Point | 285.7±28.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H312-H332 Details | ||||||||||||||||||||
| Precautionary Statements | P264-P270-P280-P301+P312+P330-P302+P352+P312-P363-P402+P404-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for N-(9-Fluorenylmethoxycarbonyl)-(2S,4R)-4-methylproline |