Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Linezolid Impurity 26 |
|---|---|
| Synonyms | Benzyl 4-morpholinophenylcarbamate |
| Molecular Structure |  |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.36 |
| CAS Registry Number | 348626-43-7 |
| SMILES | C1COCCN1C2=CC=C(C=C2)NC(=O)OCC3=CC=CC=C3 |
| Solubility | 17.42 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.618, Calc.* |
| Melting point | 165.61 ºC |
| Boiling Point | 424.96 ºC, 463.1±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 233.9±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Linezolid Impurity 26 |