| Dafeng Chemical Com.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 16773308882 | |||
![]() |
927608786@qq.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2013 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 2-(Carboxymethyl)-4-fluorobenzoic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H7FO4 |
| Molecular Weight | 198.15 |
| CAS Registry Number | 500779-09-9 |
| EC Number | 817-282-3 |
| SMILES | C1=CC(=C(C=C1F)CC(=O)O)C(=O)O |
| Solubility | 1.117e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.577, Calc.* |
| Melting point | 135.63 ºC |
| Boiling Point | 360.30 ºC, 383.6±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 185.8±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H315-H319-H335 Details | ||||||||||||||||||||||||
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2-(Carboxymethyl)-4-fluorobenzoic acid |