| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 1,4-Bis((1H-imidazol-1-yl)methyl)benzene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 |
| CAS Registry Number | 56643-83-5 |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)CN3C=CN=C3 |
| Solubility | 154.4 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.641, Calc.* |
| Melting point | 161.22 ºC |
| Boiling Point | 411.01 ºC, 487.0±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 248.3±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis((1H-imidazol-1-yl)methyl)benzene |