| Dongguan City Betterly New Materials Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (769) 8828-8454 +86 13535083564 (Sharon Xie) +86 13713468294 (Violin Liu) +86 18320994010 (Kelly Qin) | |||
![]() |
waimaobu@betely.com | |||
![]() |
WhatsApp: +86 13535083564 (Sharon Xie) +86 13713468294 (Violin Liu) | |||
| Chemical manufacturer since 2000 | ||||
| chemBlink standard supplier since 2022 | ||||
| Name | N-{4-[2-(Piperidin-1-yl)acetamido]phenyl}ethanimidic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 |
| CAS Registry Number | 5906-75-2 |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC(=O)CN2CCCCC2 |
| Solubility | 1695 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.610, Calc.* |
| Melting point | 215.16 ºC |
| Boiling Point | 505.49 ºC, 538.9±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 279.7±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-{4-[2-(Piperidin-1-yl)acetamido]phenyl}ethanimidic acid |