Online Database of Chemicals from Around the World
| CAS 登录号 | 产品名称 | 分子式 |
|---|---|---|
| 927-74-2 | 3-Butyn-1-ol | Csub4/subHsub6/subO |
| 927-80-0 | Ethoxyethyne;Ethyl ethynyl ether | Csub4/subHsub6/subO |
| 927-83-3 | Azo-tert-butane;2,2'-Azobis(2-Methylpropane);452106_Aldrich;Azo-Tert-Butane | Csub8/subHsub18/subNsub2/sub |
| 927-86-6 | Acetylcholine perchlorate | Csub7/subHsub16/subNOsub2/sub.ClOsub4/sub |
| 928-01-8 | (Z)-2-Butenediamide;Inchi=1/C4h6n2o2/C5-3(7)1-2-4(6)8/H1-2H,(H2,5,7)(H2,6,8)/B2-1;But-2-Enedioic Acid, Diamide;2-Butenediamide, (Z)- | Csub4/subHsub6/subNsub2/subOsub2/sub |
| 928-04-1 | Acetylenedicarboxylic acid monopotassium salt;2-Butynedioic acid monopotassium salt | Csub4/subHKOsub4/sub |
| 928-40-5 | 1,5-Hexanediol;1,5-Dihydroxyhexane; 1-Methyl-1,5-pentanediol; Hexane-2,6-diol | Csub6/subHsub14/subOsub2/sub |
| 928-47-2 | S-Butyl thioacetate;Ethanethioic Acid S-Butyl Ester;Butyl Thiolacetate;Zinc01736013 | Csub6/subHsub12/subOS |
| 928-49-4 | 3-Hexyne;Diethylacetylene | Csub6/subHsub10/sub |
| 928-50-7 | 5-Chloro-1-pentene | Csub5/subHsub9/subCl |
| 928-51-8 | 4-Chloro-1-butanol;Tetramethylene chlorohydrin | Csub4/subHsub9/subClO |
| 928-55-2 | Ethyl propenyl ether;1-Ethoxypropene; Propenyl ethyl ether | Csub5/subHsub10/subO |
| 928-57-4 | 2-Chloroethyl thiocyanate;1-Chloro-2-Thiocyanato-Ethane;Zinc01734841;Nsc196140 | Csub3/subHsub4/subClNS |
| 928-64-3 | Hexylphosphonyl dichloride | Csub6/subHsub13/subClsub2/subOP |
| 928-65-4 | Trichlorohexylsilane;n-Hexyltrichlorosilane | Csub6/subHsub13/subClsub3/subSi |
| 928-68-7 | 2-Methyl-6-heptanone;6-Methyl-2-heptanone; Isooctan-2-one; Methyl isohexyl ketone; NSC 39665 | Csub8/subHsub16/subO |
| 928-72-3 | Disodium iminodiacetate;Disodium iminodi(acetate); Iminodiacetic acid disodium salt | Csub4/subHsub5/subNNasub2/subOsub4/sub |
| 928-80-3 | 3-Decanone | Csub10/subHsub20/subO |
| 928-89-2 | 6-Chlorohex-1-ene;6-Chloro-1-hexene | Csub6/subHsub11/subCl |
| 928-90-5 | 5-Hexyn-1-ol | Csub6/subHsub10/subO |
| 928-91-6 | (Z)-Hex-4-en-1-ol;cis-4-Hexen-1-ol | Csub6/subHsub12/subO |
| 928-92-7 | (E)-4-Hexen-1-ol;trans-4-Hexen-1-ol | Csub6/subHsub12/subO |
| 928-94-9 | (2Z)-2-Hexen-1-ol;(Z)-2-Hexen-1-ol; (Z)-2-Hexenol; cis-2-Hexen-1-ol; cis-2-Hexenol; cis-beta,gamma-Hexenol | Csub6/subHsub12/subO |
| 928-95-0 | trans-2-Hexen-1-ol;(E)-2-Hexen-1-ol | Csub6/subHsub12/subO |
| 928-96-1 | Leaf alcohol;cis-Hex-3-en-1-ol | Csub6/subHsub12/subO |
| 928-97-2 | (3E)-3-Hexen-1-ol;(3E)-Hexenol; (E)-3-Hexen-1-ol; (E)-3-Hexenol; trans-3-Hexen-1-ol; trans-3-Hexenol | Csub6/subHsub12/subO |
| 928-98-3 | 1,5-Pentanedithiol;Pentamethylene dimercaptan | Csub5/subHsub12/subSsub2/sub |
| 929-05-5 | (1E)-1-Ethoxy-1-butene;(1E)-1-Butenyl ethyl ether #;1-Butenyl ethyl ether;1-BUTENYLETHYLETHER | Csub6/subHsub12/subO |
| 929-06-6 | 2-(2-Aminoethoxy)ethanol;Diglycolamine; Diethylene glycolamine | Csub4/subHsub11/subNOsub2/sub |
| 929-10-2 | 6-Methylheptanoic acid;iso-Caprylic acid | Csub8/subHsub16/subOsub2/sub |
| 929-16-8 | 2-Chloroethylpalmitate;Hexadecanoic Acid 2-Chloroethyl Ester;Palmitic Acid 2-Chloroethyl Ester;2-Chloroethyl Palmitate | Csub18/subHsub35/subClOsub2/sub |
| 929-17-9 | 7-Aminoheptanoic acid | Csub7/subHsub15/subNOsub2/sub |
| 929-21-5 | 7-Chloro-1-heptene | Csub7/subHsub13/subCl |
| 929-37-3 | Di(ethylene glycol) vinyl ether;Diethylene glycol monovinyl ether | Csub6/subHsub12/subOsub3/sub |
| 929-48-6 | 7-Formylheptanoic acid;8-Ketocaprylic Acid;7-Formylheptanoic Acid | Csub8/subHsub14/subOsub3/sub |
| 929-53-3 | 1,4-Decadiyne | Csub10/subHsub14/sub |
| 929-59-9 | 1,8-Diamino-3,6-dioxaoctane;2,2'-(Ethylenedioxy)bis(ethylamine) | Csub6/subHsub16/subNsub2/subOsub2/sub |
| 929-73-7 | Dodecylamine hydrochloride;Dodecylammonium Chloride;Laurylammonium Chloride;1-Dodecanamine, Hydrochloride | Csub12/subHsub28/subClN |
| 929-75-9 | 1,11-Diamino-3,6,9-trioxaundecane;3,6,9-Trioxaundecamethylenediamine | Csub8/subHsub20/subNsub2/subOsub3/sub |
| 929-77-1 | Methyl behenate;Methyl docosanoate; Methyl n-docosanoate; NSC 158426 | Csub23/subHsub46/subOsub2/sub |
| 929-98-6 | Dinonyl sulfide;1-(Nonylsulfanyl)nonane #;diNonyl sulphide;n-Nonyl sulfide | Csub18/subHsub38/subS |
| 930-02-9 | Octadecyl vinyl ether;Vinyl octadecyl ether; 1-(Vinyloxy)octadecane | Csub20/subHsub40/subO |
| 930-21-2 | 2-Azetidinone;2-Azacyclobutanone | Csub3/subHsub5/subNO |
| 930-22-3 | Vinyloxirane;Butadiene epoxide; Butadiene monoepoxide; Butadiene monooxide; Butadiene monoxide; Butene 3,4-epoxid | Csub4/subHsub6/subO |
| 930-27-8 | 3-Methylfuran | Csub5/subHsub6/subO |
| 930-28-9 | Cyclopentyl chloride;Chlorocyclopentane | Csub5/subHsub9/subCl |
| 930-29-0 | 1-Chloro-1-cyclopentene | Csub5/subHsub7/subCl |
| 930-30-3 | 2-Cyclopentenone;2-Cyclopenten-1-one | Csub5/subHsub6/subO |
| 930-33-6 | 1,2-Dihydro-3H-1,2,4-triazol-3-one | Csub2/subHsub3/subNsub3/subO |
| 930-35-8 | Vinylene trithiocarbonate;1,3-Dithiolethione; DT 827A; Dithiolene; Isotrithione | Csub3/subHsub2/subSsub3/sub |