Online Database of Chemicals from Around the World
|
CAS#: 109742-46-3 Product: Roxbin B No suppilers available for the product. |
| Name | Roxbin B |
|---|---|
| Synonyms | Roxbin B |
| Molecular Structure |  |
| Molecular Formula | C41H28O26 |
| Molecular Weight | 936.66 |
| CAS Registry Number | 109742-46-3 |
| SMILES | C1=C8C(=C(O)C(=C1O)O)C2=C(O)C(=C(O)C=C2C(OC7OC4C(OC(=O)C3=CC(=C(O)C(=C3C5=C(C(OC4)=O)C=C(O)C(=C5O)O)O)O)C(OC(=O)C6=CC(=C(O)C(=C6)O)O)C7OC8=O)=O)O |
| InChI | 1S/C41H28O26/c42-13-1-8(2-14(43)24(13)48)36(57)65-34-33-19(7-62-37(58)9-3-15(44)25(49)29(53)20(9)21-10(38(59)64-33)4-16(45)26(50)30(21)54)63-41-35(34)66-39(60)11-5-17(46)27(51)31(55)22(11)23-12(40(61)67-41)6-18(47)28(52)32(23)56/h1-6,19,33-35,41-56H,7H2 |
| InChIKey | ACMCMQPOKYONNT-UHFFFAOYSA-N |
| Density | 2.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 1662.739°C at 760 mmHg (Cal.) |
| Flash point | 495.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Roxbin B |