Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68082-29-1 | Fatty acids C18-unsatd dimers polymers with tall-oil fatty acids and triethylenetetramine | |
| 68082-65-5 | Gilsonite, polymer with linseed oil and tung oil | |
| 68083-14-7 | Dimethyldiphenyl siloxanes and silicones | |
| 68083-18-1 | Polysiloxanes di-Me Me vinyl vinyl group-terminated | |
| 68083-19-2 | Vinyl terminated polydimethyl siloxane | |
| 68084-49-1 | Cerium neodecanoate | Ce(C10H20O2)3 |
| 68085-85-8 | Cyhalothrin | C23H19ClF3NO3 |
| 68089-73-6 | 9H-Tribenzo[a,c,e]cyclohepten-9-one | C19H12O |
| 68089-86-1 | (Chloromethyl)triphenylphosphonium iodide | C19H17ClP.I |
| 68090-88-0 | Boc-4-chloro-L-phenylalanine | C14H18ClNO4 |
| 68092-71-7 | 1-[2-(Chlorodimethylsilyl)ethyl]-3(or 4)-(chloromethyl)benzene | C11H16Cl2Si |
| 68097-13-2 | 6-Prenylapigenin | C20H18O5 |
| 68099-86-5 | Bepridil hydrochloride | C24H34N2O.HCl |
| 68104-63-2 | 4-Piperazinobenzonitrile | C11H13N3 |
| 68104-99-4 | 4-Cyclopentyl-3-oxobutyric acid ethyl ester | C11H18O3 |
| 68105-02-2 | Dimethylditetradecylammonium bromide | C30H64N.Br |
| 68105-93-1 | 1-Bromo-7-chloroheptane | C7H14BrCl |
| 68108-18-9 | (S)-4-Hydroxy-2-pyrrolidinone | C4H7NO2 |
| 68109-72-8 | Diethylammonium dihydrogen phosphate | C4H14NO4P |
| 68110-31-6 / 61931-49-5 | Reactive Green 19 | C40H23Cl2N15O19S6.6Na |
| 68112-21-0 | 3,5-Dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxy-2H-pyran-2-one | C24H40O4 |
| 68119-31-3 | 2-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)acetonitrile | C9H5F2NO2 |
| 68120-41-2 | 1-Bromo-1-[3-(trifluoromethyl)phenyl]ethane | C9H8BrF3 |
| 68120-44-5 | 4-Bromo-3-chlorobenzyl bromide | C7H5Br2Cl |
| 68121-36-8 | 2,4,4,4-Tetrachlorobutyryl chloride | C4H3Cl5O |
| 68121-46-0 | 3,5-Dichlorothioanisole | C7H6Cl2S |
| 68122-86-1 | Quaternium 27 | |
| 68123-16-0 | 1,3-Butadiene, telomer with bromotrichloromethane, ethenylbenzene and 2-methyl-2-propenoic acid | |
| 68123-30-8 | 2,3-Dihydroxanthotoxol | C11H8O4 |
| 68124-04-9 | Chonglou Saponin VII | C51H82O21 |
| 68124-64-1 | Tetrabutylammonium phthalate | 2(C16H36N).C8H4O4 |
| 68127-19-5 | Spirostan | C39H62O13 |
| 68127-22-0 | (-)-Menthyl (+)-2-pyrrolidone-5-carboxylate | C15H25NO3 |
| 68128-53-0 | Amylostatin XG | C19H33NO13 |
| 68128-59-6 | 4-(Octadecylamino)-4-oxosulfobutanoic acid diammonium salt | C22H43NO6S.2(NH3) |
| 68130-14-3 | Acetylated distarch phosphate | C2H4O2.x(H3PO4).x(C6H10O5) |
| 68130-20-1 | Starch phthalate | |
| 68130-47-2 | C8-10-Alkyl Alcohols ethoxylated phosphates | |
| 68130-55-2 | Hexanedioic acid, mixed esters with decanoic acid, heptanoic acid, octanoic acid and pentaerythritol | |
| 68130-60-9 | 2-Methyl-2-propenoic acid polymer with ethenylbenzene ethyl 2-propenoate and N-(hydroxymethyl)-2-propenamide butylated | |
| 68130-75-6 | Phosphoric acid, C14-18 and C16-18-unsatd. alkyl esters, sodium salts | |
| 68131-04-4 | Humic acid sodium salt | |
| 68131-32-8 | Fermented spent sulfite liquor | |
| 68131-37-3 | Hydrolyzed starch syrups, dehydrated | |
| 68131-73-7 | Polyethylene-polyamines | |
| 68131-77-1 | Petroleum resins | |
| 68132-21-8 | Perilla Oil | |
| 68132-83-2 | alpha(or beta)-Methyl-1H-imidazole-1-ethanol | C6H10N2O |
| 68133-69-7 | Disperse Red 177 | C20H18N6O4S |
| 68133-79-9 | 2-(3,7-Dimethyl-2,6-octadien-1-yl)cyclopentanone | C15H24O |