Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 68957-50-6 | 5-Bromo-6-methyl-3-nitro-2-pyridinamine | C6H6BrN3O2 |
| 68957-94-8 | Propylphosphonic anhydride | C9H21O6P3 |
| 68958-32-7 | 2-Propenoic acid, polymer with 2-hydroxyethyl 2-propenoate, 4-hydroxy-N-(2-hydroxyethyl)-N-methylbutanamide, 1,1'-methylenebis[4-isocyanatocyclohexane], 2-oxepanone and 2,2'-oxybis[ethanol] | |
| 68958-35-0 | (Chloromethyl)oxirane polymer with N-(6-aminohexyl)-N'-[6-[(6-aminohexyl)amino]hexyl]-1,6-hexanediamine N-(6-aminohexyl)-1,6-hexanediamine and N,N'-bis(6-aminohexyl)-1,6-hexanediamine | |
| 68959-15-9 | Citric acid sodium titanium salt | Na2Ti.(C6H5O7)2 |
| 68959-20-6 | Disiquonium chloride | C27H60NO3Si.Cl |
| 68959-87-5 | Tris(isopropylcyclopentadienyl)lanthanum(III) | C27H57La |
| 68960-97-4 | 1,14-Diamino-3,6,9,12-tetraoxatetradecane | C10H24N2O4 |
| 68963-75-7 | 2,4-Dichloro-6-hydroxypyridine | C5H3Cl2NO |
| 68971-49-3 | Fluorescent Brightener 264 | C40H38N12Na6O22S6 |
| 68971-82-4 | p-tert-Butylhydroxycalix[8]arene | C88H112O8 |
| 68973-27-3 | L-Alanyl-L-lysine monohydrochloride | C9H19N3O3.HCl |
| 68975-47-3 | Isoheptene | C7H14 |
| 68978-04-1 | Mulberrofuran A | C25H28O4 |
| 68983-70-0 | 1-(4-Methylphenyl)-1-cyclopentanecarbonitrile | C13H15N |
| 68985-04-6 | Metoprolol Impurity 29 | C15H25NO3 |
| 68985-08-0 | 2,4-Mesitylenedisulfonyl dichloride | C9H10Cl2O4S2 |
| 68986-76-5 | Copper(I) thiophene-2-carboxylate | C5H3CuO2S |
| 68988-57-8 | Silicic acid tetraethyl ester reaction products with chlorodimethylsilane | C8H20O4Si.C2H7ClSi |
| 68988-92-1 | Wright's stain | |
| 68989-19-5 | Pigment Violet 3 | |
| 68989-45-7 | Caseins, palmitoyl derivs. | |
| 68989-52-6 | Collagens, octanoyl | |
| 68990-09-0 | Beef extract | |
| 68990-15-8 | Fenugreek Oils | |
| 68990-30-7 | Balsams, Douglas-fir, molybdenum salts | |
| 68990-49-8 | Fatty acids, tall-oil, reaction products with diethylenetriamine, tetraethylenepentamine and triethylenetetramine | |
| 68990-53-4 | C14-22 monoglycerides | |
| 68990-74-9 | Dandelion extract | |
| 68991-72-0 | Fatty acids, dehydrated castor-oil, magnesium salts | |
| 68991-84-4 | Fatty acids vegetable-oil reaction products with tetraethylenepentamine | |
| 69002-84-2 | 5-Hydroxydiclofenac | C14H11Cl2NO3 |
| 69002-85-3 | 3'-Hydroxydiclofenac | C14H11Cl2NO3 |
| 69003-28-7 | 2,2-Dichloro-N-(2-methylphenyl)propanamide | C10H11Cl2NO |
| 69004-03-1 | Toltrazuril | C18H14F3N3O4S |
| 69004-04-2 | Toltrazuril sulfone | C18H14F3N3O6S |
| 69004-15-5 | Toltrazuril sulfoxide | C18H14F3N3O5S |
| 69008-71-5 | 4-(N,N-Dibutylamino)pyridine | C13H22N2 |
| 69011-19-4 | Diethenylbenzene polymer with ethenylbenzene and ethenylethylbenzene chloromethylated trimethylamine-quaternized | |
| 69011-36-5 | alpha-Tridecyl-omega-hydroxypoly(oxy-1,2-ethanediyl) branched | |
| 69012-64-2 | Silica fumes | |
| 69012-79-9 | Calcined zinc ore concentrates | |
| 69012-86-8 | Ashes (residues), zinc-refining | |
| 69013-23-6 | Hydride terminated methyhydrosiloxane dimethylsiloxane copolymer | |
| 69021-86-9 | Tris(isopropylcyclopentadienyl)praseodymium | C24H33Pr |
| 69022-52-2 | 2,5-Dimethyl-3-nitrobenzaldehyde | C9H9NO3 |
| 69022-53-3 | (E)-3-(2,5-Dimethyl-3-nitrophenyl)-2-propenoic acid | C11H11NO4 |
| 69022-82-8 | 2,3-Dihydro-2,7-dimethylfuro[2,3-c]pyridine | C9H11NO |
| 69029-39-6 | Ethoxylated propoxylated di-sec-butylphenol | C14H22O.(C3H6O)n.(C2H4O)x |
| 69032-13-9 | Dibenzyl iminodicarboxylate | C16H15NO4 |