Online Database of Chemicals from Around the World
| CAS No | Product Name | Molecular Formula |
|---|---|---|
| 6397-33-7 | 2-(Isopropylthio)aniline | C9H13NS |
| 6398-51-2 | alpha-(2-Propenyl)-2-furanmethanol | C8H10O2 |
| 6398-87-4 | 3-(1,3-Dioxolan-2-yl)aniline | C9H11NO2 |
| 6398-98-7 | Amodiaquin dihydrochloride dihydrate | C20H22ClN3O.2(HCl).2(H2O) |
| 6399-79-7 | Phosphorous acid 1,1-dimethyl-3-oxobutyl dipropyl ester | C12H25O4P |
| 6399-81-1 | Triphenylphosphine hydrobromide | C18H15P.HBr |
| 6402-23-9 | Ethacridine lactate monohydrate | C15H15N3O.C3H6O3.H2O |
| 6403-16-3 | N-L-Seryl-L-glutamic acid | C8H14N2O6 |
| 6403-17-4 | L-Seryl-L-alanine | C6H12N2O4 |
| 6404-26-8 | N-Boc-N'-acetyl-L-lysine | C13H24N2O5 |
| 6404-28-0 | N-(tert-Butoxycarbonyl)norleucine | C11H21NO4 |
| 6404-29-1 | Boc-6-aminohexanoic acid | C11H21NO4 |
| 6404-31-5 | N-Benzyloxycarbonyl-D-proline | C13H15NO4 |
| 6406-53-7 | Solvent Red 32 | C24H20N4O7S2.x(C12H23N) |
| 6406-56-0 | Acid Red 151 | C22H15N4O4S.Na |
| 6407-78-9 | Solvent Yellow 18 | C18H18N4O |
| 6407-80-3 | Solvent Yellow 18 | C15H11N3O2 |
| 6408-02-2 | C.I. Acid Violet 56 | C32H16Cl2CrN4O10S2.H.Na2 |
| 6408-29-3 | Acid Violet 90 | C40H27CrN8Na2O10S2 |
| 6408-31-7 | Acid Red 183 | C16H10ClCrN4O9S2.2Na |
| 6408-33-9 | Acid Orange 61 | |
| 6408-35-1 | Mordant Yellow 66 | C13H8N2Na2O6S |
| 6408-50-0 | Solvent Blue 63 | C22H18N2O2 |
| 6408-57-7 | Acid Green 27 | C34H32N2O8S2.2Na |
| 6408-72-6 / 12217-95-7 | Disperse Violet 26 | C26H18N2O4 |
| 6408-78-2 | Acid Blue 25 | C20H14N2O5S.Na |
| 6408-82-8 | Mordant Violet 2 | C17H10N2Na2O6S |
| 6409-48-9 | 2,5-Diaminobenzene-1,3-disulfonic acid | C6H8N2O6S2 |
| 6409-77-4 | Nuclear Fast Red | C14H8NO7S.Na |
| 6410-10-2 | Para Red | C16H11N3O3 |
| 6410-21-5 | Solvent Red 13 | C17H13N3O4 |
| 6410-26-0 | Pigment Red 21 | C23H16ClN3O2 |
| 6410-29-3 | Pigment Red 32 | C31H24N4O4 |
| 6410-30-6 | Pigment Red 8 | C24H17ClN4O4 |
| 6410-32-8 | Pigment Red 12 | C25H20N4O4 |
| 6410-38-4 | Pigment Red 9 | C24H17Cl2N3O3 |
| 6410-41-9 | Pigment Red 5 | C30H31ClN4O7S |
| 6411-21-8 | 1,2-Bis(diethylphosphino)ethane | C10H24P2 |
| 6411-34-3 | 4-Allyloxyphenol | C9H10O2 |
| 6412-87-9 | 5,6-Methylenedioxy-1-indanone | C10H8O3 |
| 6413-10-1 | Fructone | C8H14O4 |
| 6414-69-3 | Ethyl 3-iodopropanoate | C5H9IO2 |
| 6415-07-2 | Tris(pyrrolidinophosphine) oxide | C12H24N3OP |
| 6415-59-4 | Sedanolide | C12H18O2 |
| 6416-66-6 | Tracid Brilliant Red B | C29H20ClN3O10S3.2Na |
| 6417-36-3 | Mordant Red 21 | C36H26N4Na2O9S2 |
| 6417-46-5 | Pigment Blue 56 | C40H35N3O3S |
| 6417-83-0 | Pigment Red 63:1 | C21H12CaN2O6S |
| 6418-38-8 | 2,3-Difluorophenol | C6H4F2O |
| 6418-41-3 | 3-Methyltridecane | C14H30 |