Products of Polymer
CAS No. | Product Name | Molecular Formula |
---|
104219-63-8 | Amberlite XAD 16 | |
109292-17-3 | 2-methyl-2-Propenoic acid polymer with ethyl 2-propenoate and alpha-octadecyl-omega-(2-propenyloxy)poly(oxy-1,2-ethanediyl) | C32H60O6 |
11111-34-5 | ETHYLENEDIAMINE TETRAKIS(PROPOXYLATE-BLOCK-ETHOXYLATE) TETROL | C22H14 |
11128-96-4 | Amberlite La 2 | |
11139-85-8 | Chelex 100 | |
112-35-6 | Triethylene glycol monomethyl ether | C7H16O4 |
120246-33-5 | Carboxypolystyrene resin | |
122560-63-8 | Ethenylbenzene polymer with diethenylbenzene and ethenyl-N,N,N-trimethylbenzenaminium chloride | |
12627-85-9 | Dowex1X8 | |
132739-31-2 | 3-[1-[(2-Methylpropan-2-Yl)Oxy]Propan-2-Yloxy]Propan-1-Ol | C10H22O3 |
136392-67-1 | 1,9-Decadiene-maleic anhydride-methyl vinyl ether copolymer | (C10H18)x.(C4H2O3)x.(C3H6O)x |
136392-68-2 | Poly(Vinyl Acetate-CO-Butyl Maleate-CO-Isobornyl Acrylate) | |
136445-69-7 | melissicAlkyl PVP | |
1365700-43-1 | StratoSpheres PL-Wang resin | |
139948-75-7 | Polyisoprene-graft-maleic anhydride | (C5H8)x.(C9H10O3)y |
143606-53-5 | 1,4-Butanediol-1,6-hexane diisocyanate-succinic acid copolymer | |
148411-57-8 | Chitosan lactate (ester) | |
149146-26-9 | Ion Exchange Resins、chloroType | |
1569-01-3 | 1-Propoxy-2-propanol | C6H14O2 |
160611-46-1 | poly(styrene-maleic anhydride)moietyterminusIsooctanoicester,isopropPhen | |
160611-48-3 | Poly(Styrene-Co-Maleic Acid) Partial Propyl Ester Cumene Terminated | |
160611-51-8 | poly(styrene-maleic anhydride)moietyterminuscyclohexyl/isopropester,isopropPhen | |
1990-77-8 | Syringaresinol diacetate | C26H30O10 |
2393-92-2 | Glycine (2R,3R)-2-[(2,2-Dichloroacetyl)Amino]-3-Hydroxy-3-[4-(Methylsulfonyl)Phenyl]Propyl ester | C14H18Cl2N2O6S |
24936-41-2 | 1-Methyl-4-Vinylbenzene | C9H10 |
24936-50-3 | 1-Bromo-4-Ethenyl-Benzene Homopolymer | |
24937-16-4 | Nylon 12 | |
24937-78-8 | Ethylene-vinyl acetate copolymer | (C2H4)x.(C4H6O2)y |
24937-79-9 | Polyvinylidene fluoride | (C2H2F2)n |
24938-16-7 | Methacrylic Acid Butyl Ester Polymer With 2-(Dimethylamino)Ethyl Meth-Acrylate And Methyl Methacrylate | C21H37NO6 |
24938-37-2 | Poly(Ethylene Adipate) | C8H15O6 |
24968-79-4 | Acrylonitrile-Methyl Acrylate Copolymer | |
24969-06-0 | 2-(Chloromethyl)-Oxirane Homopolymer | |
24969-11-7 | Formaldehyde, polymer with 1,3-benzenediol | |
24980-41-4 | 2-Oxepanone homopolymer | (C6H10O2)x |
24981-13-3 | Acrylamide-styrene copolymer | (C8H8)x.(C3H5NO)x |
24991-47-7 | Poly(4-chlorostyrene) | (C8H7Cl)n |
24993-04-2 | Nylon 6/66 | C18H37N3O5 |
25014-31-7 | Poly(alpha-Methylstyrene) | C9H10 |
25014-41-9 | Acrylonitrile polymers | (C3H3N)x |
25034-86-0 | Poly(Styrene-Co-Methyl Methacrylate) | C13H16O2 |
25035-04-5 | Nylon 11 | [-NH(CH2)10CO-]n |
25035-69-2 | n-Butyl acrylate-methacrylic acid-methyl methacrylate copolymer | |
25035-71-6 | Toluenesulfonamide formaldehyde resin | (C7H10NO2S)n |
25036-01-5 | Acenaphthylene | C12H8 |
25036-25-3 | Poly(Bisphenol A-co-epichlorohydrin) glycidyl end-capped | (C18H22O3)n.C22H26O4 |
25037-45-0 | Polycarbonate | C16H18O5 |
25038-02-2 | 2,2,3-Trifluoro-3-(Trifluoromethyl)-Oxirane Homopolymer | |
25038-32-8 | Ethenylbenzene; 2-methylbuta-1,3-diene | C13H16 |
25038-54-4 | Amilan PA 6 | (C6H11NO)n |
25038-59-9 | Poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl) | (C10H8O4)n |
25038-72-6 | Poly(Vinylidene Chloride-Co-Methyl Acrylate) | C6H8Cl2O2 |
25038-74-8 | Nylon 12 | C12H23NO |
25038-87-3 | poly(Ethylenemethylone) | C4H6O |
25053-15-0 | POLY(DIALLYL PHTHALATE) | |
25053-53-6 | Poly(Ethylene-CO-Methacrylic Acid) | C6H10O2 |
25067-34-9 | Poly(vinyl alcohol-co-ethylene) | (C2H4O)x.(C2H4)x |
25068-26-2 | Poly(4-Methyl-1-Pentene) | C6H12 |
25068-38-6 | Poly(bisphenol-A-co-epichlorohydrin) | |
25085-50-1 | Alkylphenol disulfide | (C10H14O)n.(CH2O)n |
25085-83-0 | Poly(Benzyl Methacrylate) | C11H12O2 |
25086-15-1 | Carboset Xpd 1234 | C9H14O4 |
25086-29-7 | Vinylpyrrolidinone-Styrene Polymer | C42H51N3O3 |
25086-48-0 | Vinyl chloride-vinyl acetate-vinyl alcohol copolymer | (C4H6O2)x.(C2H4O)x.(C2H3Cl)x |
25086-89-9 | Poly(1-vinylpyrrolidone-co-vinyl acetate) | (C6H9NO)n.(C4H6O2)m |
25087-26-7 | Polymethacrylic Acid | C4H5NaO2 |
25103-87-1 | Poly(1,4-Butylene Adipate) | C10H20O6 |
25104-37-4 | 5-(3 Or 6-Oxo-1-Cyclohexen-1-Yl)-5-Ethylbarbituric Acid | C4H8O |
25119-62-4 | Styrene-Allyl Alcohol Copolymer | C11H14O |
25119-68-0 | Monobutyl maleate-vinyl methyl ether copolymer | |
25133-97-5 | Acrylates copolymer | |
25135-51-7 | Polysulfone A | |
25154-01-2 | Polysulfone | C27H24Cl2O4S |
25189-55-3 | N-(1-Methylethyl)-2-Propenamide Homopolymer | C6H11NO |
25190-06-1 | Poly(tetrahydrofuran) | H.(C4H8O)n.OH |
25212-86-6 | 2-Furanmethanol homopolymer | (C5H6O2)n |
25214-14-6 | Hexanedioic acid, polymer with 2,2-dimethyl-1,3-propanediol and 1,6-hexanediol | C17H36O8 |
25214-39-5 | Poly(Acrylonitrile-Co-Vinylidene Chloride-Co-Methyl Methacrylate) | C10H13Cl2NO2 |
25232-41-1 | 4-Ethenyl-Pyridine Homopolymer | C7H7N |
25249-16-5 | 2-Hydroxyethyl 2,2-dimethylbutanoate | C6H10O3 |
25266-02-8 | 2,5-Furandione polymer with 1-octadecene | C22H38O3 |
25301-02-4 | Tyloxapol | |
25569-53-3 | Poly(ethylene succinate) | (C4H6O4)x.(C2H6O2)x |
25608-12-2 | Potassium polyacrylate | (C3H6O2)n.(C3H5KO2)m |
25608-33-7 | Butyl methacrylate-methyl methacrylate polymer | |
25609-89-6 | Poly(Vinyl Acetate-Co-Crotonic Acid) | C8H12O4 |
25618-55-7 | Polyglycerine | (C3H8O3)n |
25639-21-8 | Octadecyl methacrylate polymer | (C22H42O2)x |
25702-80-1 | Poly(Vinyl Chloride) Carboxylated | C5H7ClO2 |
25703-79-1 | 2-Hydroxypropyl 2-Methylprop-2-Enoate | C7H12O3 |
25719-51-1 | 2-Ethylhexyl 2-Methylprop-2-Enoate | C12H22O2 |
25722-45-6 | chemicallyModifiedPolyacrylic | C7H8O3 |
25736-61-2 | Maleic anhydride-styrene copolymer | C12H10O3 |
25736-86-1 | alpha-(2-Methyl-1-Oxo-2-Propen-1-Yl)-omega-Hydroxy-Poly(Oxy-1,2-Ethanediyl) | C6H10O3 |
25768-50-7 | poly(Cyclohexyl Acrylate) | (C10H16O2)n |
25777-71-3 | Q F Resin | C15H22O6 |
25791-96-2 | Propoxylated glycerin | C3H8O3.(C3H6O)n |
25805-17-8 | 2-Ethyl-4,5-Dihydro-Oxazole Homopolymer | C5H9NO |
25986-80-5 | poly(hexadecanoicmethacrylate) | (C20H38O2)n |
25987-06-8 | Polyethylenimine | (C2H8N2)n.(C2H5N)n |
25988-97-0 | Poly(2-hydroxypropyldimethylammonium chloride) | (C5H12ClNO)n |
259886-50-5 | Cucurbit[7]uril | C42H42N28O14 |
259886-51-6 | Cucurbit[8]uril | C48H48N32O16 |
26009-03-0 | Poly[Oxy(1-Oxo-1,2-Ethanediyl)] | C6H6O5 |
26023-30-3 | Polylactic acid | (C3H4O2)n |
26061-90-5 | Poly(ethylene-co-glycidyl methacrylate) pellets | |
26062-79-3 | Poly(diallyldimethylammonium chloride) | (C8H16ClN)n |
26099-09-2 | Polymaleic acid | (C4H4O4)n |
26100-51-6 | ($+/-$)-Lactic acid homopolymer | (C3H6O3)x |
26124-68-5 | Glycolic acid homopolymer | C2H4O3 |
26142-30-3 | Polypropylenglycol diglycidyl ether | (C3H6O)n.C6H10O3 |
26316-40-5 | Ethylenediamine ethoxylated propoxylated polymer | C2H8N2.4(C2H4O)x.4(C3H6O)n |
26402-79-9 | Phenoxy Resin | |
26426-80-2 | Maleic anhydride, isobutylene copolymer | C8H10O3 |
26426-91-5 | 1,6-Diisocyanatohexane 2,4-diisocyanato-1-methylbenzene | C17H18N4O4 |
26590-05-6 | Poly(acrylamide-co-diallyldimethylammonium chloride) | |
26658-46-8 | POLYETHYLENEIMINE | |
26678-93-3 | Formaldehyde polymer with 4-(1,1,3,3-tetramethylbutyl)phenol | C15H24O2 |
26680-10-4 | 3,6-Dimethyl-1,4-dioxane-2,5-dione homopolymer | (C6H8O4)n |
26762-29-8 | Poly(styrene-co-Maleic anhydride), cuMene terMinated | |
26780-50-7 | Lactide-glycolide polymer | |
26780-96-1 | Poly(1,2-dihydro-2,2,4-trimethylquinoline) | (C12H15N)n |
27083-27-8 | Poly(hexamethylenebicyanoguanide-hexamethylenediamine) hydrochloride | (C10H18N8)m.(C6H16N2)n.x(HCl) |
27119-07-9 | Rheothik 80-11 | C7H13NO4S |
27599-56-0 | Poly(acrylic acid), partial sodium salt-graft-poly(ethylene oxide) | |
27924-99-8 | POLYHYDROXYSTEARIC ACID | |
28208-80-2 | Poly(Ethylene-Co-Acrylic Acid), Zinc Salt | C5H7O2Zn |
28210-41-5 | Tolevamer | (C8H8O3S)n |
28211-18-9 | VP/EICOSENE COPOLYMER | C26H49NO |
28410-56-2 | Poly(acetaldehyde-resorcinol) | (C8H8O2)n |
28571-95-1 | poly(styrene-CO-maleic acid) | C24H32O8 |
29117-08-6 | Poly(ethyleneglycol) 2-[ethyl[(heptadecafluorooctyl)sulfonyl]amino]ethyl ether | C12H10F17NO3S.(C2H4O)n |
29132-58-9 | Acrylic acid maleic acid copolymer | (C4H4O4)n.(C3H4O2)n |
29435-48-1 | 3-Hydroxybutanoate | C4H7O3 |
30499-70-8 | Trimethylolpropane triglycidyl ether | C15H26O6 |
30551-89-4 | Poly(allylamine) | (C3H7N)n |
30581-59-0 | Poly(1-Vinylpyrrolidone-Co-2-Dimethylaminoethyl Methacrylate) | C14H24N2O3 |
31075-24-8 | Mayosperse 60 | (C10H24Cl2N2O)n |
31212-13-2 | Poly(Acrylic Acid-Co-Acrylamide), Potassium Salt | |
31692-85-0 | Tetrahydrofurfuryl alcohol polyethylene glycol ether | (C2H4O)nC5H10O2 |
31852-84-3 | Poly(trimethylene carbonate) | (C4H6O3)n |
31959-78-1 | Styrene Maleic Anhydride Copolymer | C17H16O7 |
32610-77-8 | Formaldehyde-phenol-triethylenetetramine copolymer | C13H26N4O2 |
32844-27-2 | Tetrabromobisphenol-A polycarbonate | (C15H16O2)m.(C15H12Br4O2)n.(CCl2O)x |
35429-19-7 | Polyquaternium-32 | (C9H18ClNO2)n.(C3H5NO)m |
36290-04-7 | Formaldehyde-2-naphthalenesulfonic acid copolymer sodium salt | (C10H8O3S)n.(CH2O)n.xNa |
36890-68-3 | Poly(Caprolactone) Diol | |
37231-60-0 | Methyl-Oxirane polymer with oxirane, monooctadecanoate | C23H45O4 |
37286-64-9 | Polypropylene glycol monomethyl ether | CH4O.(C3H6O)n |
37380-42-0 | Amberlite XAD 4 | |
39339-85-0 | Amberlyst A 26 | |
39389-20-3 | Divinylbenzene-styrenesulfonic acid copolymer | (C10H10)n.(C8H8O3S)m |
39420-45-6 | Poly(Propylene Glycol) (300) Monomethacrylate | C7H12O3 |
39423-51-3 | Huntsman T 403 | |
39612-00-5 | Poly(Isobutylene-Co-Maleic Acid) sodium salt | |
401916-61-8 | O-[2-(3-Mercaptopropionylamino)ethyl]-O'-methylpolyethylene glycol | |
40623-75-4 | 2-Acrylamido-2-methylpropanesulfonic acid-acrylic acid copolymer | (C7H13NO4S)x.(C3H4O2)y |
40957-99-1 | Medioresinol | C21H24O7 |
50586-59-9 | Trimethylolpropane Ethoxylate | |
51274-37-4 | 2,3-Oxiranedicarboxylic acid homopolymer | (C4H4O5)x |
53633-54-8 | Polyquaternium-11 | (C8H15NO2)x.(C6H9NO)y.(C4H10O4S)z |
53879-54-2 | Trimethylolpropane propoxylate triacrylate | |
54640-82-3 | Poly(2-Acrylamido-2-Methyl-1-Propanesulfonic Acid-Co-Acrylonitrile) | |
55279-75-9 | Formyl Polystyrene Resin | C7H5O |
55295-98-2 | Cyano-guanidine polymer with ammonium chloride and formaldehyde | C3H10ClN5O |
55464-99-8 | Amberlite IRP 69 | |
55844-94-5 | Chloromethylstyrene-divinylbenzene-styrene copolymer | (C10H10)m.(C9H9Cl)n.(C8H8)x |
60177-39-1 | Chloromethylated Aminated Stryene-Divinylbenzene Resin | |
60267-37-0 | DOWEX(R) 1X8 | |
60303-68-6 | Poly-tert-butylphenoldisulfide | (C10H14O)x.(Cl2S2)y |
61788-89-4 | C36 Dimer acid | C36H64O4 |
61788-97-4 | Resin epoxy | (C11H12O3)n |
61789-92-2 | Mastic (resin) | |
62649-23-4 | Polyacrylamide | C9H12NNaO5 |
62929-02-6 | Polyimide Resin | C35H28N2O7 |
63148-65-2 | Poly(vinyl butyral) | |
63181-94-2 | Divinylbenzene-Vinylbenzyldimethyl(hydroxyethyl)ammonium Chloride Polymer | C23H30ClNO |
63502-25-0 | Tetrakis(hydroxymethyl)phosphonium sulfate urea polymer | [(C4H12O4P)2.SO4.(CH4N2O)2]n |
63705-03-3 | Polyglycerine-3 | C45H88O9 |
64333-21-7 | Ion Exchange Resins | |
64742-16-1 | Petroleum resins | |
64754-90-1 | Polyethylene chlorinated | |
65530-63-4 | 2,2'-Iminobisethanol Compd. With C8-18 Perfluoroalkylethyl Phosphate | C11H28F3N2O8P |
65530-66-7 | 2-(Perfluoroalkyl)ethyl methacrylate | C10H9F9O2.(C2F4)n |
65605-70-1 | Perfluoroalkylethyl acrylate | C9H7F9O2.(C2F4)n |
66070-58-4 | Butadiene-styrene polymer | C12H14 |
68002-19-7 | butanolModifiedureaaldehyderesin | C2H6N2O2 |
68002-20-0 | 1,3,5-Triazine-2,4,6-triamine, polymer with formaldehyde, methylated | |
68002-25-5 | 1,3,5-Triazine-2,4,6-triamine, polymer with formaldehyde, butyl ether | |
68037-39-8 | Ethene homopolymer chlorinated chlorosulfonated | |
68037-40-1 | 2,5-Furandione polymer with ethenylbenzene sulfonated sodium salt | (C8H8)x.(C4H2O3)x.xNa |
68239-42-9 | alpha-Hydro-omega-hydroxypoly(oxy-1,2-ethanediyl) ether with methyl beta-D-glucopyranoside (4:1) | (C2H4O)n(C2H4O)n(C2H4O)n(C2H4O)nC7H14O6 |
68410-23-1 | Polyamide Resins | |
68441-17-8 | Ethene, homopolymer, oxidized | |
68441-33-8 | Duolite C-26 Ion-Exchange Resin | C18H18Na |
68441-58-7 | 2-Methyl-1,3-Butadiene Homopolymer Chlorinated | C5H8 |
68442-33-1 | 1-Propene, Homopolymer, Chlorinated | |
68555-36-2 | Polyquaternium-2 | (C11H26N4O)n.(C4H8Cl2O)n |
68555-98-6 | 4-(1,1-Dimethylpropyl)-Phenol polymer with sulfur chloride | |
68584-77-0 | PEG-15 cocoPolyamine | |
68610-51-5 | Poly(dicyclopentadiene-co-p-cresol) | |
68610-92-4 | Polyquaternium-10 | |
68648-89-5 | Butylene-Ethylene-Styrene Copolymer | C13H16 |
68649-12-7 | poly(1-decen)Hydride | [CH2CH[(CH2)7CH3]]n |
68797-57-9 | Imidazole-epichlorohydrin copolymer | |
68891-50-9 | Acrylonitrile-Butadiene Copolymer | C10H13NO2 |
69011-19-4 | Diethenylbenzene polymer with ethenylbenzene and ethenylethylbenzene chloromethylated trimethylamine-quaternized | |
69011-20-7 | Agrion C-100 Ion Exchange Resins | C28H30 |
69418-26-4 | Polyquaternium-33 | (C8H16ClNO2)x.(C3H5NO)x |
69430-35-9 | [Kita] Esol N50s | |
69772-06-1 | Ion Exchange Resins | |
69991-67-9 | 1,1,2,3,3,3-Hexafluoro-1-propene oxidized polymd. | |
70788-40-8 | Dimethyl-Benzenesulfonic Acid Polymer With Formaldehyde Sodium Salt | C9H11NaO4S |
71342-77-3 | TBBPA carbonate oligomer BC58 | (C7H2Br3O2).(C16H10Br4O3)n.(C6H2Br3O) |
71550-12-4 | Poly(allylamine hydrochloride) | (C3H7N)n.xHCl |
71750-71-5 | Polyethylene Monoalcohol | C14H30O |
73138-88-2 | (Phenylsilsesquioxane)-(Dimethylsiloxane) Copolymer | |
74398-71-3 | 12-(Glycidyloxy)oleic acid glycerol ester | C66H116O12 |
75345-27-6 | Polidronium chloride | |
76050-42-5 | Carbomer 940 | |
76930-03-5 | Amberlite(R) IRA-35 | |
8007-47-4 | Canadian Balsam, Neutral | |
8023-91-4 | GalbanuM oil | |
80262-44-8 | Cucurbit[6]uril hydrate | C36H36N24O12.12(H2O) |
8050-31-5 | Resin acids esters with glycerol | |
80747-90-6 | AMBERLITE(R) IRA-67 | |
81859-24-7 | Polyquaternium-10 | |
84170-74-1 | 3-[2,2-Dimethyl-3-(3-prop-2-enoyloxypropoxy)propoxy]propyl prop-2-enoate | C17H28O6 |
85026-55-7 | (2E)-3-Phenyl-2-propen-1-yl beta-D-glucopyranoside | C15H20O6 |
88497-56-7 | Brominated polystyrene | |
9000-75-3 | Elemi Oil | |
9002-29-3 | Amberlite Irc 50 | |
9002-83-9 | Fluorolube grease, gr-362 | C2ClF3 |
9002-84-0 | Poly(tetrafluoroethylene) | (C2F4)n |
9002-85-1 | Vinylidene chloride | C2H2Cl2 |
9002-86-2 | Polyvinyl chloride | (C2H3Cl)n |
9002-98-6 | Polyethyleneimine | |
9003-01-4 | Polyacrylic acid | (C3H4O2)n |
9003-06-9 | Poly(acrylamide-co-acrylic acid) | |
9003-07-0 | Polypropylene | (C3H6)n |
9003-08-1 | 1,3,5-Triazine-2,4,6-triamine-formaldehyde copolymer | |
9003-09-2 | Poly(vinyl methyl ether) | C3H6O |
9003-13-8 | Polypropylene glycol monobutyl ether | C4H10O.(C3H6O)n |
9003-17-2 | 1,3-Butadiene homopolymer | (C4H6)x |
9003-18-3 | Acrylonitrile, polymer with 1,3-butadiene | |
9003-21-8 | polyPropenoic Acid Methyl Ester | C4H6O2 |
9003-22-9 | Poly(vinyl chloride-co-vinyl acetate) | C6H9ClO2 |
9003-32-1 | Poly(ethyl acrylate) | C5H8O2 |
9003-33-2 | 1,1'-[Methylenebis(Oxy)]Bis-Ethene Homopolymer | C5H8O2 |
9003-35-4 | Phenol-formaldehyde resin | (C6H6O)n.(CH2O)n |
9003-44-5 | poly1-(Ethyleneoxy)-2-Methylpropane | [CH2CH[OCH2CH(CH3)2]]n |
9003-49-0 | Butyl acrylate resin | (C7H12O2)n |
9003-54-7 | Poly(styrene-co-acrylonitrile) | |
9003-56-9 | ABS Resins | |
9003-63-8 | Poly(butyl methacrylate) | C8H14O2 |
9003-70-7 | POLY(STYRENE-CO-DIVINYLBENZENE) | |
9003-74-1 | Terpene resin | |
9003-77-4 | Poly(2-ethylhexyl acrylate) | C11H20O2 |
9003-95-6 | POLY(VINYL STEARATE) | |
9003-96-7 | Poly(vinyl stearyl ether) | (C20H40O)n |
9005-12-3 | Poly[oxy(methylphenylsilylene)] | (C7H8OSi)n |
9006-26-2 | Ethylene Maleic Anhydride Co-Polymer | C6H6O3 |
9009-54-5 | Polyurethane | |
9010-69-9 | Resin acids zinc salts | |
9010-76-8 | 2-Propenenitrile polymer with 1,1-dichloroethene | C5H5Cl2N |
9010-77-9 | Aclyn 540A | C5H8O2 |
9010-79-1 | Ethene, Polymer With 1-Propene | C5H10 |
9010-86-0 | Poly(ethylene-co-ethyl acrylate) | C7H12O2 |
9010-88-2 | Poly(Methyl Methacrylate) | C10H16O4 |
9010-92-8 | Styron G 9001 | C12H14O2 |
9010-98-4 | Polychloroprene | (C4H5Cl)n |
9011-05-6 | Urea formaldehyde | C3H8N2O3 |
9011-06-7 | Poly(vinylidene chloride-co-vinyl chloride) | C4H5Cl3 |
9011-11-4 | Ethenylbenzene copolymer with (1-methylethenyl)benzene | C17H18 |
9011-14-7 | Methacrylic acid methyl ester polymers | (C5H8O2)x |
9011-15-8 | POLY(ISOBUTYL METHACRYLATE) | |
9017-21-4 | Ethenylmethyl-Benzene Homopolymer | C9H10 |
9017-27-0 | Poly(Vinyltoluene-Co-alpha-Methylstyrene) | C18H20 |
9017-40-7 | Reillex X 425 | C17H17N |
9017-79-2 | AMbersep 900(OH), ion exchange resin | |
9035-99-8 | Insoluble sulfur | (S)n |
9036-15-1 | MERRIFIELD RESIN | |
9037-24-5 | Amberlyst 15 | |
9038-95-3 | Polyalkylene glycol monobutyl ether | |
9042-82-4 | PPG-12/SMDIcopolymer | |
9046-10-0 | O,O'-Bis(2-aminopropyl)polypropyleneglycol | |
9048-57-1 | Polypropylene polyol diphenylmethanediisocyanate prepolymer | C15H10N2O2.H.(C3H6O)n.OH |
9050-06-0 | Poly(vinyl cinnamate) | (C11H10O2)n |
9052-45-3 | 2-Propenoic acid polymer with diethenyl benzene | C13H14O2 |
9052-95-3 | Divinylbenzene, ethylvinylbenzene, vinylbenzene copolymer | C28H30 |
9056-59-1 | Amberlite IRA 68 | |
9060-05-3 | 1-[2-(Diphenylmethoxy)ethyl]-4-(3-phenylpropyl)piperazine | C28H34N2O |
9085-42-1 | 1X2Ion Exchange Resins | N/A |
92450-99-2 | O-[2-(3-SuccinylaMino)ethyl]-O′-Methyl-polyethylene glycol 20′000 | |
94334-64-2 | TBBPA carbonate oligomer BC52 | (C7H5O2).(C16H10Br4O3)n.(C6H5O) |
96077-04-2 | 1-[1-(1-Propoxypropoxy)propoxy]-1-propanol | C12H26O4 |
96087-10-4 | Massoniresinol | C20H24O8 |
99734-09-5 | Tristyrylphenol ethoxylates | C30H24O.(C2H4O)n |