Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 | www.purerechem.com | |||
 | +86 (551) 6288-8437 +86 18096409024 | |||
 | info@purerechem.com | |||
 | QQ Chat | |||
 | Skype Chat | |||
 | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | (Dimethylamino)ethyl p-aminobenzoate |
|---|---|
| Synonyms | 2-(dimethylamino)ethyl 4-aminobenzoate |
| Molecular Structure |  |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 10012-47-2 |
| SMILES | CN(C)CCOC(=O)C1=CC=C(C=C1)N |
| Solubility | 5.614e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.556, Calc.* |
| Melting point | 95.85 °C |
| Boiling Point | 323.08 °C, 346.6±22.0 °C (760 mmHg), Calc.* |
| Flash Point | 163.4±22.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (Dimethylamino)ethyl p-aminobenzoate |