Online Database of Chemicals from Around the World
|
CAS#: 52461-48-0 Product: Dimethylaminoethyl Acetylsalicylate No suppilers available for the product. |
| Name | Dimethylaminoethyl Acetylsalicylate |
|---|---|
| Synonyms | 2-Dimethylaminoethyl 2-Acetoxybenzoate; 2-Acetoxybenzoic Acid 2-Dimethylaminoethyl Ester; Benzoic Acid, 2-(Acetyloxy)-, 2-(Dimethylamino)Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 |
| CAS Registry Number | 52461-48-0 |
| SMILES | C1=C(C(=CC=C1)C(=O)OCCN(C)C)OC(=O)C |
| InChI | 1S/C13H17NO4/c1-10(15)18-12-7-5-4-6-11(12)13(16)17-9-8-14(2)3/h4-7H,8-9H2,1-3H3 |
| InChIKey | SWNNLZURDOQIQO-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 329.861°C at 760 mmHg (Cal.) |
| Flash point | 153.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylaminoethyl Acetylsalicylate |