| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Natural product >> Terpenes |
|---|---|
| Name | Piscidinol A |
| Synonyms | (5R,9R,10R,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S,4R,5S)-4,5,6-trihydroxy-6-methylheptan-2-yl]-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 |
| CAS Registry Number | 100198-09-2 |
| SMILES | C[C@@H](C[C@H]([C@@H](C(C)(C)O)O)O)[C@@H]1CC[C@]2([C@]1(CC[C@H]3C2=CC[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
| Solubility | 0.008222 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.548, Calc.* |
| Melting point | 232.90 °C |
| Boiling Point | 599.4±50.0 °C (760 mmHg), Calc.*, 543.46 °C |
| Flash Point | 330.3±26.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Piscidinol A |