| Nanjing Aribo Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.ariboreagent.com | |||
![]() | +86 19951442182 | |||
![]() | sales@ariboreagent.com | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 6,6''-Dibromo-2,2':6',2''-terpyridine |
|---|---|
| Synonyms | 2,6-bis(6-bromopyridin-2-yl)pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9Br2N3 |
| Molecular Weight | 391.06 |
| CAS Registry Number | 100366-66-3 |
| EC Number | 623-737-5 |
| SMILES | C1=CC(=NC(=C1)C2=NC(=CC=C2)Br)C3=NC(=CC=C3)Br |
| Solubility | 2.245 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.654, Calc.* |
| Melting point | 194.23 °C |
| Boiling Point | 460.68 °C, 473.0±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 239.9±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 6,6''-Dibromo-2,2':6',2''-terpyridine |