Online Database of Chemicals from Around the World
|
CAS#: 100649-20-5 Product: 1,2-Epoxyestrenolone No suppilers available for the product. |
| Name | 1,2-Epoxyestrenolone |
|---|---|
| Synonyms | 1,2-Epoxyestrene-3-One-17-Ol; 1,2-Epoxyestrenolone; Estr-4-En-3-One, 1,2-Epoxy-17-Hydroxy-, (1Alpha,2Alpha,17Beta)- |
| Molecular Structure |  |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 |
| CAS Registry Number | 100649-20-5 |
| SMILES | [C@@H]45C(C=C3CC[C@H]2[C@@H]1CC[C@@H]([C@@]1(C)CC[C@@H]2[C@H]3[C@@H]4O5)O)=O |
| InChI | 1S/C18H24O3/c1-18-7-6-11-10(12(18)4-5-14(18)20)3-2-9-8-13(19)16-17(21-16)15(9)11/h8,10-12,14-17,20H,2-7H2,1H3/t10-,11+,12+,14+,15+,16-,17+,18+/m1/s1 |
| InChIKey | HCYOOIAQUCRMRB-OZDRGRBASA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.224°C at 760 mmHg (Cal.) |
| Flash point | 171.087°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Epoxyestrenolone |