| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | 15,16-Epoxy-15-ethoxy-6beta,13-dihydroxylabd-8-en-7-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.52 |
| CAS Registry Number | 1374328-47-8 |
| SMILES | CCOC1CC(CO1)(CCC2=C(C(=O)[C@H]([C@@H]3[C@@]2(CCCC3(C)C)C)O)C)O |
| Density | 1.1±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.535, Calc.* |
| Boiling Point | 522.8±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 174.5±23.6 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 15,16-Epoxy-15-ethoxy-6beta,13-dihydroxylabd-8-en-7-one |