Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (24) 466-2929 | |||
|
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,3,5,7-Adamantanetetracarboxylic acid |
|---|---|
| Synonyms | 1,3,5,7-adamantane tetracarboxylic acid; 1,3,5,7-Adamantanetetracarboxylic acid; 1,3,5,7-Adamantanetetracarboxylic acid # |
| Molecular Structure |  |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 |
| CAS Registry Number | 100884-80-8 |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)C(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | 1S/C14H16O8/c15-7(16)11-1-12(8(17)18)4-13(2-11,9(19)20)6-14(3-11,5-12)10(21)22/h1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | VWAIZPYLEYEEFK-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 212.0±23.8°C (Cal.) |
| Refractive index | 1.722 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3,5,7-Adamantanetetracarboxylic acid |