| Dancheng Huatai Biological Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.htbioth.com | |||
![]() | +86 13482210809 | |||
![]() | hli@3wpharm.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13482210809 | |||
![]() | WhatsApp:13482210809 | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Mebicar |
|---|---|
| Synonyms | 1,3,4,6-tetramethyl-3a,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 10095-06-4 |
| EC Number | 682-123-5 |
| SMILES | CN1C2C(N(C1=O)C)N(C(=O)N2C)C |
| Solubility | 2.652e+005 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.535, Calc.* |
| Melting point | 120.78 °C |
| Boiling Point | 339.91 °C, 362.2±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 171.9±20.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302 Details |
| Safety Statements | P264-P270-P301+P317-P330-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Mebicar |