Online Database of Chemicals from Around the World
|
CAS#: 1093-07-8 Product: Mecambrine No suppilers available for the product. |
| Name | Mecambrine |
|---|---|
| Synonyms | (-)-Mecambrine; Fugapavine; C09588 |
| Molecular Structure |  |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 |
| CAS Registry Number | 1093-07-8 |
| SMILES | [C@H]13CC5(C2=C4C(=CC(=C12)CCN3C)OCO4)C=CC(C=C5)=O |
| InChI | 1S/C18H17NO3/c1-19-7-4-11-8-14-17(22-10-21-14)16-15(11)13(19)9-18(16)5-2-12(20)3-6-18/h2-3,5-6,8,13H,4,7,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | NMVDXQMYKKNYFO-ZDUSSCGKSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.583°C at 760 mmHg (Cal.) |
| Flash point | 230.538°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mecambrine |