Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-Anilinobenzenediazonium Chloride |
|---|---|
| Synonyms | 4-Phenylazanylbenzenediazonium Chloride; P-Diazoniumdiphenylamine Chloride |
| Molecular Structure |  |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.68 |
| CAS Registry Number | 101-56-4 |
| EINECS | 202-954-5 |
| SMILES | C1=CC(=CC=C1NC2=CC=CC=C2)[N+]#N.[Cl-] |
| InChI | 1S/C12H10N3.ClH/c13-15-12-8-6-11(7-9-12)14-10-4-2-1-3-5-10;/h1-9,14H;1H/q+1;/p-1 |
| InChIKey | GREMVPUSQUHWDU-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 4-Anilinobenzenediazonium Chloride |