Online Database of Chemicals from Around the World
|
CAS#: 17040-20-9 Product: 4-Anilinobenzoic Acid No suppilers available for the product. |
| Name | 4-Anilinobenzoic Acid |
|---|---|
| Synonyms | Nsc158046 |
| Molecular Structure |  |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 |
| CAS Registry Number | 17040-20-9 |
| SMILES | C1=CC(=CC=C1C(O)=O)NC2=CC=CC=C2 |
| InChI | 1S/C13H11NO2/c15-13(16)10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H,(H,15,16) |
| InChIKey | DPAMLADQPZFXMD-UHFFFAOYSA-N |
| Density | 1.269g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.238°C at 760 mmHg (Cal.) |
| Flash point | 200.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Anilinobenzoic Acid |