| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,3,5,6-Tetrafluorophenyl Methacrylate |
|---|---|
| Synonyms | 2,3,5,6-tetrafluorophenyl 2-methylprop-2-enoate; 4H-Tetrafluorophenyl methacrylate; MFCD00129959 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 |
| CAS Registry Number | 101156-31-4 |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)C(C)=C |
| InChI | 1S/C10H6F4O2/c1-4(2)10(15)16-9-7(13)5(11)3-6(12)8(9)14/h3H,1H2,2H3 |
| InChIKey | DDQNBJUNTSWDDM-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| 1.3 (Expl.) | |
| Boiling point | 245.222°C at 760 mmHg (Cal.) |
| Flash point | 99.202°C (Cal.) |
| 110°C (Expl.) | |
| Refractive index | 1.452 (Cal.) |
| Safety Description | Irritant |
|---|---|
| R36/37/38 | |
| S23,S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6-Tetrafluorophenyl Methacrylate |