Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3,3,3-Tetrafluoro-1-Phenyl-1-Propanone |
|---|---|
| Synonyms | 2,3,3,3-tetrafluoro-1-phenylpropan-1-one |
| Molecular Structure |  |
| Molecular Formula | C9H6F4O |
| Molecular Weight | 206.14 |
| CAS Registry Number | 2267-65-4 |
| SMILES | O=C(C(F)C(F)(F)F)c1ccccc1 |
| InChI | 1S/C9H6F4O/c10-8(9(11,12)13)7(14)6-4-2-1-3-5-6/h1-5,8H |
| InChIKey | MGVPMFSYZYUVSV-UHFFFAOYSA-N |
| Density | 1.291g/cm3 (Cal.) |
|---|---|
| Boiling point | 189.644°C at 760 mmHg (Cal.) |
| Flash point | 69.82°C (Cal.) |
| Refractive index | 1.432 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,3,3-Tetrafluoro-1-Phenyl-1-Propanone |