Online Database of Chemicals from Around the World
|
CAS#: 101342-93-2 Product: 4-Hydroxycibenzoline No suppilers available for the product. |
| Name | 4-Hydroxycibenzoline |
|---|---|
| Synonyms | 4-[2-(4,5-Dihydro-1H-Imidazol-2-Yl)-1-Phenyl-Cyclopropyl]Phenol; P-Hydroxycibenzoline; 4-Hydroxycibenzoline |
| Molecular Structure |  |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 |
| CAS Registry Number | 101342-93-2 |
| SMILES | C4=C(C1(C(C1)C2=NCCN2)C3=CC=CC=C3)C=CC(=C4)O |
| InChI | 1S/C18H18N2O/c21-15-8-6-14(7-9-15)18(13-4-2-1-3-5-13)12-16(18)17-19-10-11-20-17/h1-9,16,21H,10-12H2,(H,19,20) |
| InChIKey | CDEJORMMVLZMBY-UHFFFAOYSA-N |
| Density | 1.263g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.957°C at 760 mmHg (Cal.) |
| Flash point | 257.375°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxycibenzoline |