Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Hydroxychrysene |
|---|---|
| Synonyms | 3-Chrysenol; 3-06-00-03729 (Beilstein Handbook Reference); 3-Hydroxychrysene |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 63019-39-6 |
| SMILES | C1=CC4=C(C2=C1C3=C(C=C2)C=CC(=C3)O)C=CC=C4 |
| InChI | 1S/C18H12O/c19-14-8-5-13-7-9-16-15-4-2-1-3-12(15)6-10-17(16)18(13)11-14/h1-11,19H |
| InChIKey | PULKTNQKGZNFNB-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.238°C at 760 mmHg (Cal.) |
| Flash point | 240.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxychrysene |