Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Chloro-2,4,5-Trifluorobenzoyl Fluoride |
|---|---|
| Synonyms | 3-chloro-2,4,5-trifluorobenzoyl fluoride |
| Molecular Structure |  |
| Molecular Formula | C7HClF4O |
| Molecular Weight | 212.53 |
| CAS Registry Number | 101513-76-2 |
| SMILES | Fc1cc(c(F)c(Cl)c1F)C(F)=O |
| InChI | 1S/C7HClF4O/c8-4-5(10)2(7(12)13)1-3(9)6(4)11/h1H |
| InChIKey | DVXDXLUGMVTANY-UHFFFAOYSA-N |
| Density | 1.58g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.472°C at 760 mmHg (Cal.) |
| Flash point | 88.348°C (Cal.) |
| Refractive index | 1.457 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2,4,5-Trifluorobenzoyl Fluoride |