Online Database of Chemicals from Around the World
| Name | 1-Chloro-2,3,5-Trifluoro-4,6-Diisocyanatobenzene |
|---|---|
| Synonyms | 1-Chloro-2,3,5-Trifluoro-4,6-Diisocyanato-Benzene |
| Molecular Structure |  |
| Molecular Formula | C8ClF3N2O2 |
| Molecular Weight | 248.55 |
| CAS Registry Number | 46495-66-3 |
| EINECS | 256-271-2 |
| SMILES | O=C=NC1=C(F)C(=C(F)C(=C1Cl)F)N=C=O |
| InChI | 1S/C8ClF3N2O2/c9-3-4(10)5(11)8(14-2-16)6(12)7(3)13-1-15 |
| InChIKey | RDSWPXZXPBCUPU-UHFFFAOYSA-N |
| Density | 1.604g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.839°C at 760 mmHg (Cal.) |
| Flash point | 137.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2,3,5-Trifluoro-4,6-Diisocyanatobenzene |
