Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (24) 466-2929 | |||
|
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 1,3,5-Triisothiocyanatobenzene |
|---|---|
| Synonyms | 3-13-00-00555 (Beilstein Handbook Reference); Brn 3293763; Isothiocyanic Acid, S-Phenenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C9H3N3S3 |
| Molecular Weight | 249.32 |
| CAS Registry Number | 101670-67-1 |
| SMILES | S=C=NC1=CC(=CC(=C1)N=C=S)N=C=S |
| InChI | 1S/C9H3N3S3/c13-4-10-7-1-8(11-5-14)3-9(2-7)12-6-15/h1-3H |
| InChIKey | LLJPDGVAIMDGFS-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.333°C at 760 mmHg (Cal.) |
| Flash point | 262.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Triisothiocyanatobenzene |