Online Database of Chemicals from Around the World
|
CAS#: 139254-91-4 Product: Triisoselenocyanato-Methylsilane No suppilers available for the product. |
| Name | Triisoselenocyanato-Methylsilane |
|---|---|
| Synonyms | Triisoselenocyanato-Methyl-Silane; Tri(Isoselenocyanato)Methyl Silane |
| Molecular Structure |  |
| Molecular Formula | C4H3N3Se3Si |
| Molecular Weight | 358.05 |
| CAS Registry Number | 139254-91-4 |
| SMILES | [Se]=C=N[Si](C)(N=C=[Se])N=C=[Se] |
| InChI | 1S/C4H3N3Se3Si/c1-11(5-2-8,6-3-9)7-4-10/h1H3 |
| InChIKey | VAZMKLXVVJYSRG-UHFFFAOYSA-N |
| Boiling point | 288.579°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 128.329°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triisoselenocyanato-Methylsilane |